Attributes
UniProt ID
Protein Name
Chaperone protein ClpB
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6W6E
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6w6eA1e6w6eA2e6w6eA3e6w6eA4e6w6eB1e6w6eB2e6w6eB3e6w6eB4e6w6eC1e6w6eC2e6w6eC3e6w6eC4e6w6eD1e6w6eD2e6w6eD3e6w6eD4e6w6eE1e6w6eE2e6w6eE3e6w6eE4e6w6eF1e6w6eF2e6w6eF3e6w6eF4e6w6eI1e6w6eI2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P9WPD0 | DB16833 | ADP | 6w6e | e6w6eE1 | E:756-845 |
| P9WPD0 | DB16833 | ADP | 6w6e | e6w6eE3 | E:548-755 |
| P9WPD0 | DB16833 | ADP | 6w6e | e6w6eF1 | F:159-340 |
| P9WPD0 | DB16833 | ADP | 6w6e | e6w6eF3 | F:340-409,F:530-548 |
| P9WPD0 | DB16833 | ADP | 6w6g | e6w6gE2 | E:548-755 |
| P9WPD0 | DB16833 | ADP | 6w6g | e6w6gE4 | E:756-845 |
| P9WPD0 | DB16833 | ADP | 6w6g | e6w6gF2 | F:340-407,F:530-548 |
| P9WPD0 | DB16833 | ADP | 6w6g | e6w6gF4 | F:159-340 |
| P9WPD0 | DB16833 | ADP | 6w6h | e6w6hE1 | E:756-845 |
| P9WPD0 | DB16833 | ADP | 6w6h | e6w6hE2 | E:548-755 |
| P9WPD0 | DB16833 | ADP | 6w6i | e6w6iE1 | E:756-845 |
| P9WPD0 | DB16833 | ADP | 6w6i | e6w6iE2 | E:548-755 |
| P9WPD0 | DB16833 | ADP | 6w6i | e6w6iF2 | F:159-340 |
| P9WPD0 | DB16833 | ADP | 6w6i | e6w6iF4 | F:341-468,F:532-548 |
| P9WPD0 | DB16833 | ADP | 6w6j | e6w6jE2 | E:548-755 |
| P9WPD0 | DB16833 | ADP | 6w6j | e6w6jE4 | E:756-845 |
| P9WPD0 | DB16833 | ADP | 6w6j | e6w6jF3 | F:341-468,F:532-548 |
| P9WPD0 | DB16833 | ADP | 6w6j | e6w6jF4 | F:159-340 |
| P9WPD0 | DB16833 | ADP | 7l6n | e7l6nE2 | E:548-755 |
| P9WPD0 | DB16833 | ADP | 7l6n | e7l6nE3 | E:756-845 |
| P9WPD0 | DB16833 | ADP | 7l6n | e7l6nF2 | F:340-409,F:530-548 |
| P9WPD0 | DB16833 | ADP | 7l6n | e7l6nF4 | F:159-340 |