Attributes
UniProt ID
Protein Name
Mycocyclosin synthase
Ligand Name
PROTOPORPHYRIN IX CONTAINING FE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES
Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5IBD
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5ibdA1
ECOD domains from experimental PDB structures interacting with ligand DB18267
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P9WPP6 | DB18267 | HEM | 5ibd | e5ibdA1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 5ibe | e5ibeA1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 5ibf | e5ibfA1 | A:4-396 |
| P9WPP6 | DB18267 | HEM | 5o4k | e5o4kA1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 5o4l | e5o4lA1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 5op9 | e5op9A1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 5opa | e5opaA1 | A:4-396 |
| P9WPP6 | DB18267 | HEM | 5wp2 | e5wp2A1 | A:2-396 |
| P9WPP6 | DB18267 | HEM | 6geo | e6geoA1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 6geq | e6geqA1 | A:2-396 |
| P9WPP6 | DB18267 | HEM | 6rq0 | e6rq0A1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 6rq1 | e6rq1A1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 6rq3 | e6rq3A1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 6rq5 | e6rq5A1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 6rq6 | e6rq6A1 | A:4-396 |
| P9WPP6 | DB18267 | HEM | 6rq8 | e6rq8A1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 6rq9 | e6rq9A1 | A:3-396 |
| P9WPP6 | DB18267 | HEM | 6rqb | e6rqbA1 | A:4-396 |
| P9WPP6 | DB18267 | HEM | 6rqd | e6rqdA1 | A:4-396 |
| P9WPP6 | DB18267 | HEM | 6rqe | e6rqeA1 | A:4-396 |
| P9WPP6 | DB18267 | HEM | 6te7 | e6te7A1 | A:6-396 |
| P9WPP6 | DB18267 | HEM | 6tet | e6tetA1 | A:5-396 |
| P9WPP6 | DB18267 | HEM | 6tev | e6tevA1 | A:6-396 |
| P9WPP6 | DB18267 | HEM | 6upg | e6upgA1 | A:2-396 |
| P9WPP6 | DB18267 | HEM | 6upi | e6upiA1 | A:2-396 |