Attributes
UniProt ID
Protein Name
Adenosylmethionine-8-amino-7-oxononanoate aminotransferase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4WYA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4wyaA1e4wyaA2e4wyaB1e4wyaB2e4wyaC1e4wyaC2e4wyaD1e4wyaD2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P9WQ81 | DB00114 | PLP | 4wya | e4wyaA2 | A:7-340 |
| P9WQ81 | DB00114 | PLP | 4wya | e4wyaB2 | B:7-340 |
| P9WQ81 | DB00114 | PLP | 4wya | e4wyaC2 | C:7-340 |
| P9WQ81 | DB00114 | PLP | 4wya | e4wyaD2 | D:7-340 |
| P9WQ81 | DB00114 | PLP | 4wyc | e4wycA2 | A:8-339 |
| P9WQ81 | DB00114 | PLP | 4wyc | e4wycB2 | B:7-339 |
| P9WQ81 | DB00114 | PLP | 4wyd | e4wydA2 | A:8-340 |
| P9WQ81 | DB00114 | PLP | 4wyd | e4wydB2 | B:7-340 |
| P9WQ81 | DB00114 | PLP | 4wye | e4wyeA2 | A:8-339 |
| P9WQ81 | DB00114 | PLP | 4wye | e4wyeB2 | B:7-339 |
| P9WQ81 | DB00114 | PLP | 4wyf | e4wyfA2 | A:8-339 |
| P9WQ81 | DB00114 | PLP | 4wyf | e4wyfB2 | B:8-339 |
| P9WQ81 | DB00114 | PLP | 4wyg | e4wygA2 | A:8-339 |
| P9WQ81 | DB00114 | PLP | 4wyg | e4wygB2 | B:8-339 |
| P9WQ81 | DB00114 | PLP | 4xew | e4xewA2 | A:8-339 |
| P9WQ81 | DB00114 | PLP | 4xew | e4xewB1 | B:8-339 |
| P9WQ81 | DB00114 | PLP | 4xjl | e4xjlA2 | A:8-339 |
| P9WQ81 | DB00114 | PLP | 4xjl | e4xjlB2 | B:8-339 |
| P9WQ81 | DB00114 | PLP | 4xjm | e4xjmA2 | A:8-339 |
| P9WQ81 | DB00114 | PLP | 4xjm | e4xjmB2 | B:8-339 |
| P9WQ81 | DB00114 | PLP | 4xjo | e4xjoA2 | A:8-340 |
| P9WQ81 | DB00114 | PLP | 4xjo | e4xjoB1 | B:8-339 |
| P9WQ81 | DB00114 | PLP | 4xjp | e4xjpA2 | A:8-339 |
| P9WQ81 | DB00114 | PLP | 4xjp | e4xjpB1 | B:8-339 |