Attributes
UniProt ID
Protein Name
Uricase
Ligand Name
GUANINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UYTPUPDQBNUYGX-UHFFFAOYSA-N
SMILES
c1[nH]c2c(n1)C(=O)NC(=N2)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1XT4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1xt4A1e1xt4A2
ECOD domains from experimental PDB structures interacting with ligand DB02377
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q00511 | DB02377 | GUN | 1xt4 | e1xt4A2 | A:137-295 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3A1 | A:1-136 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3A2 | A:137-295 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3B1 | B:1-136 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3B2 | B:137-295 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3C1 | C:1-136 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3C2 | C:137-295 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3D1 | D:1-136 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3D2 | D:137-295 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3E1 | E:1-136 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3E2 | E:137-295 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3F1 | F:1-136 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3F2 | F:137-295 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3G1 | G:1-136 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3G2 | G:137-295 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3H1 | H:1-136 |
| Q00511 | DB02377 | GUN | 1xy3 | e1xy3H2 | H:137-295 |