Attributes
UniProt ID
Protein Name
Succinate dehydrogenase iron-sulfur subunit, mitochondrial
Ligand Name
PROTOPORPHYRIN IX CONTAINING FE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES
Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1ZOY
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1zoyA1e1zoyA4e1zoyA5e1zoyB1e1zoyB2e1zoyC1e1zoyD1
ECOD domains from experimental PDB structures interacting with ligand DB18267
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q007T0 | DB18267 | HEM | 1zoy | e1zoyB1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 1zp0 | e1zp0B1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3abv | e3abvB1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3ae1 | e3ae1B1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3ae2 | e3ae2B1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3ae3 | e3ae3B1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3ae4 | e3ae4B1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3ae5 | e3ae5B1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3ae6 | e3ae6B1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3ae7 | e3ae7B1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3ae8 | e3ae8B1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3ae9 | e3ae9B1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3aea | e3aeaB1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3aeb | e3aebB1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3aec | e3aecB1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3aed | e3aedB1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3aee | e3aeeB1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3aef | e3aefB1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3aeg | e3aegB1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3sfd | e3sfdB1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 3sfe | e3sfeB1 | B:115-247 |
| Q007T0 | DB18267 | HEM | 4ytp | e4ytpB2 | B:115-247 |
| Q007T0 | DB18267 | HEM | 4yxd | e4yxdB2 | B:115-247 |