Attributes
UniProt ID
Protein Name
ATP-dependent 6-phosphofructokinase, platelet type
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4U1R
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4u1rA1e4u1rA2e4u1rA3e4u1rA4e4u1rB1e4u1rB2e4u1rB3e4u1rB4e4u1rC1e4u1rC2e4u1rC3e4u1rC4e4u1rD1e4u1rD2e4u1rD3e4u1rD4
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q01813 | DB00171 | ATP | 4u1r | e4u1rA3 | A:25-178,A:313-407 |
| Q01813 | DB00171 | ATP | 4u1r | e4u1rB1 | B:25-178,B:313-407 |
| Q01813 | DB00171 | ATP | 4u1r | e4u1rB2 | B:179-312 |
| Q01813 | DB00171 | ATP | 4u1r | e4u1rC1 | C:25-178,C:313-407 |
| Q01813 | DB00171 | ATP | 4u1r | e4u1rC3 | C:179-312 |
| Q01813 | DB00171 | ATP | 4u1r | e4u1rD4 | D:25-178,D:313-407 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjA2 | A:13-178,A:313-407 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjA4 | A:179-312 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjB1 | B:179-312 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjB3 | B:14-178,B:313-407 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjC2 | C:179-312 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjC4 | C:14-178,C:313-407 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjD2 | D:14-178,D:313-407 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjD4 | D:179-312 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjE3 | E:14-178,E:313-407 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjE4 | E:179-312 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjF2 | F:179-312 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjF4 | F:15-178,F:313-407 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjG1 | G:179-312 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjG4 | G:14-178,G:313-407 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjH1 | H:179-312 |
| Q01813 | DB00171 | ATP | 4xyj | e4xyjH3 | H:21-178,H:313-407 |