Attributes
UniProt ID
Protein Name
Dual specificity mitogen-activated protein kinase kinase 1
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1S9J
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1s9jA1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q02750 | DB00171 | ATP | 1s9j | e1s9jA1 | A:61-275,A:306-382 |
| Q02750 | DB00171 | ATP | 2p55 | e2p55A1 | A:61-275,A:306-382 |
| Q02750 | DB00171 | ATP | 3dv3 | e3dv3A1 | A:61-275,A:307-382 |
| Q02750 | DB00171 | ATP | 3dy7 | e3dy7A1 | A:62-266,A:307-364 |
| Q02750 | DB00171 | ATP | 3e8n | e3e8nA1 | A:61-275,A:306-382 |
| Q02750 | DB00171 | ATP | 3eqb | e3eqbA1 | A:61-275,A:306-382 |
| Q02750 | DB00171 | ATP | 3os3 | e3os3A1 | A:62-378 |
| Q02750 | DB00171 | ATP | 3pp1 | e3pp1A1 | A:61-275,A:307-382 |
| Q02750 | DB00171 | ATP | 3v01 | e3v01A1 | A:61-275,A:306-382 |
| Q02750 | DB00171 | ATP | 3v04 | e3v04A2 | A:61-275,A:306-382 |
| Q02750 | DB00171 | ATP | 3vvh | e3vvhA1 | A:61-275,A:306-382 |
| Q02750 | DB00171 | ATP | 3vvh | e3vvhB1 | B:61-275,B:308-382 |
| Q02750 | DB00171 | ATP | 3vvh | e3vvhC1 | C:61-268,C:307-381 |
| Q02750 | DB00171 | ATP | 4an3 | e4an3A1 | A:58-369 |