Attributes
UniProt ID
Protein Name
Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Ligand Name
FARNESYL DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWFJDQUYCIWHTN-YFVJMOTDSA-N
SMILES
CC(=CCCC(=CCCC(=CCOP(=O)(O)OP(=O)(O)O)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1FT2
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ft2A1e1ft2B1
ECOD domains from experimental PDB structures interacting with ligand DB07780
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q04631 | DB07780 | FPP | 1ft2 | e1ft2A1 | A:55-369 |
| Q04631 | DB07780 | FPP | 1jcr | e1jcrA1 | A:55-369 |
| Q04631 | DB07780 | FPP | 1kzo | e1kzoA1 | A:55-369 |
| Q04631 | DB07780 | FPP | 1o5m | e1o5mA1 | A:55-368 |
| Q04631 | DB07780 | FPP | 1sa5 | e1sa5A1 | A:55-369 |
| Q04631 | DB07780 | FPP | 2bed | e2bedA1 | A:55-366 |
| Q04631 | DB07780 | FPP | 2zir | e2zirA1 | A:55-368 |
| Q04631 | DB07780 | FPP | 2zis | e2zisA1 | A:55-368 |
| Q04631 | DB07780 | FPP | 3dpy | e3dpyA1 | A:55-369 |
| Q04631 | DB07780 | FPP | 3e30 | e3e30A1 | A:55-377 |
| Q04631 | DB07780 | FPP | 3e32 | e3e32A1 | A:55-377 |
| Q04631 | DB07780 | FPP | 3e33 | e3e33A1 | A:55-377 |
| Q04631 | DB07780 | FPP | 3e34 | e3e34A1 | A:55-377 |
| Q04631 | DB07780 | FPP | 3pz4 | e3pz4A1 | A:55-369 |
| Q04631 | DB07780 | FPP | 4gtm | e4gtmA1 | A:54-371 |
| Q04631 | DB07780 | FPP | 4gto | e4gtoA1 | A:54-370 |
| Q04631 | DB07780 | FPP | 4gtp | e4gtpA1 | A:55-369 |
| Q04631 | DB07780 | FPP | 4gtq | e4gtqA1 | A:55-369 |
| Q04631 | DB07780 | FPP | 4gtr | e4gtrA1 | A:55-369 |
| Q04631 | DB07780 | FPP | 8e9e | e8e9eA1 | A:55-377 |