Attributes
UniProt ID
Protein Name
Chlorophyll a-b binding protein, chloroplastic
Ligand Name
(3S,5R,6S,3'S,5'R,6'S)-5,6,5',6'-DIEPOXY-5,6,5',6'- TETRAHYDRO-BETA,BETA-CAROTENE-3,3'-DIOL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SZCBXWMUOPQSOX-WVJDLNGLSA-N
SMILES
CC(=CC=CC=C(C)C=CC=C(C)C=CC12C(CC(CC1(O2)C)O)(C)C)C=CC=C(C)C=CC34C(CC(CC3(O4)C)O)(C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6IJJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6ijj11e6ijj31e6ijj41e6ijj51e6ijj61e6ijj71e6ijj81e6ijjA1e6ijjA2e6ijjB1e6ijjB2e6ijjC1e6ijjD1e6ijjE1e6ijjF1e6ijjI1e6ijjJ1e6ijjK1e6ijjL1e6ijja1
ECOD domains from experimental PDB structures interacting with ligand DB03460
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q05093 | DB03460 | XAT | 6ijj | e6ijj11 | 1:55-247 |
| Q05093 | DB03460 | XAT | 6ijj | e6ijja1 | a:55-248 |
| Q05093 | DB03460 | XAT | 6ijo | e6ijo11 | 1:55-247 |
| Q05093 | DB03460 | XAT | 6ijo | e6ijoa1 | a:55-248 |
| Q05093 | DB03460 | XAT | 7dz7 | e7dz711 | 1:35-228 |
| Q05093 | DB03460 | XAT | 7dz7 | e7dz7a1 | a:35-228 |
| Q05093 | DB03460 | XAT | 7dz8 | e7dz811 | 1:35-228 |
| Q05093 | DB03460 | XAT | 7dz8 | e7dz8a1 | a:35-228 |
| Q05093 | DB03460 | XAT | 7zq9 | e7zq911 | 1:35-228 |
| Q05093 | DB03460 | XAT | 7zq9 | e7zq9Z1 | Z:35-228 |
| Q05093 | DB03460 | XAT | 7zqc | e7zqc11 | 1:35-228 |
| Q05093 | DB03460 | XAT | 7zqc | e7zqcZ1 | Z:35-228 |
| Q05093 | DB03460 | XAT | 7zqd | e7zqd11 | 1:35-228 |
| Q05093 | DB03460 | XAT | 7zqd | e7zqd121 | 12:35-228 |
| Q05093 | DB03460 | XAT | 7zqd | e7zqdZ1 | Z:35-228 |
| Q05093 | DB03460 | XAT | 7zqd | e7zqdZ21 | Z2:35-228 |