Attributes
UniProt ID
Protein Name
Carminomycin 4-O-methyltransferase DnrK
Ligand Name
S-ADENOSYL-L-HOMOCYSTEINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZJUKTBDSGOFHSH-WFMPWKQPSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)CSCCC(C(=O)O)N)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1TW2
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1tw2A1e1tw2A2e1tw2B1e1tw2B2
ECOD domains from experimental PDB structures interacting with ligand DB01752
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q06528 | DB01752 | SAH | 1tw2 | e1tw2A2 | A:99-351 |
| Q06528 | DB01752 | SAH | 1tw2 | e1tw2B2 | B:99-351 |
| Q06528 | DB01752 | SAH | 1tw3 | e1tw3A2 | A:99-351 |
| Q06528 | DB01752 | SAH | 1tw3 | e1tw3B2 | B:99-351 |
| Q06528 | DB01752 | SAH | 4wxh | e4wxhA2 | A:98-352 |
| Q06528 | DB01752 | SAH | 4wxh | e4wxhB1 | B:98-352 |
| Q06528 | DB01752 | SAH | 5eeh | e5eehA1 | A:99-352 |
| Q06528 | DB01752 | SAH | 5eeh | e5eehB1 | B:99-352 |
| Q06528 | DB01752 | SAH | 5eeh | e5eehC1 | C:99-353 |
| Q06528 | DB01752 | SAH | 5jr3 | e5jr3A1 | A:99-353 |
| Q06528 | DB01752 | SAH | 5jr3 | e5jr3B2 | B:100-352 |
| Q06528 | DB01752 | SAH | 5jr3 | e5jr3C2 | C:100-353 |
| Q06528 | DB01752 | SAH | 7owb | e7owbA1 | A:99-356 |
| Q06528 | DB01752 | SAH | 7oy1 | e7oy1A1 | A:99-355 |
| Q06528 | DB01752 | SAH | 7oy1 | e7oy1B1 | B:99-355 |
| Q06528 | DB01752 | SAH | 7pga | e7pgaA2 | A:99-354 |
| Q06528 | DB01752 | SAH | 7pga | e7pgaB2 | B:99-354 |
| Q06528 | DB01752 | SAH | 7pga | e7pgaC2 | C:99-354 |
| Q06528 | DB01752 | SAH | 7pga | e7pgaD2 | D:99-354 |
| Q06528 | DB01752 | SAH | 7pgj | e7pgjA1 | A:99-357 |
| Q06528 | DB01752 | SAH | 7phf | e7phfA1 | A:99-357 |
| Q06528 | DB01752 | SAH | 7phf | e7phfB1 | B:99-186,B:231-356 |
| Q06528 | DB01752 | SAH | 7phf | e7phfC2 | C:99-357 |
| Q06528 | DB01752 | SAH | 7phf | e7phfD1 | D:99-357 |