Attributes
UniProt ID
Protein Name
Bifunctional dihydrofolate reductase-thymidylate synthase
Ligand Name
10-PROPARGYL-5,8-DIDEAZAFOLIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
LTKHPMDRMUCUEB-IBGZPJMESA-N
SMILES
C#CCN(Cc1ccc2c(c1)C(=O)N=C(N2)N)c3ccc(cc3)C(=O)NC(CCC(=O)O)C(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4ECK
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4eckA2e4eckA3e4eckB2e4eckB3
ECOD domains from experimental PDB structures interacting with ligand DB03541
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q07422 | DB03541 | CB3 | 4eck | e4eckA3 | A:285-610 |
| Q07422 | DB03541 | CB3 | 4eck | e4eckB3 | B:285-610 |
| Q07422 | DB03541 | CB3 | 4eil | e4eilA2 | A:285-610 |
| Q07422 | DB03541 | CB3 | 4eil | e4eilB3 | B:285-610 |
| Q07422 | DB03541 | CB3 | 4eil | e4eilC1 | C:285-610 |
| Q07422 | DB03541 | CB3 | 4eil | e4eilD1 | D:285-610 |
| Q07422 | DB03541 | CB3 | 4eil | e4eilE1 | E:285-610 |
| Q07422 | DB03541 | CB3 | 4eil | e4eilF2 | F:285-610 |
| Q07422 | DB03541 | CB3 | 4eil | e4eilG2 | G:285-610 |
| Q07422 | DB03541 | CB3 | 4eil | e4eilH1 | H:285-610 |
| Q07422 | DB03541 | CB3 | 5t0l | e5t0lA2 | A:287-610 |
| Q07422 | DB03541 | CB3 | 5t0l | e5t0lB1 | B:285-610 |
| Q07422 | DB03541 | CB3 | 6aog | e6aogA2 | A:285-610 |
| Q07422 | DB03541 | CB3 | 6aog | e6aogB2 | B:285-610 |
| Q07422 | DB03541 | CB3 | 6aoh | e6aohA1 | A:285-610 |
| Q07422 | DB03541 | CB3 | 6aoh | e6aohB1 | B:285-610 |
| Q07422 | DB03541 | CB3 | 6aoi | e6aoiA2 | A:285-610 |
| Q07422 | DB03541 | CB3 | 6aoi | e6aoiB1 | B:285-610 |
| Q07422 | DB03541 | CB3 | 6n1s | e6n1sA2 | A:285-610 |
| Q07422 | DB03541 | CB3 | 6n1s | e6n1sB1 | B:285-610 |
| Q07422 | DB03541 | CB3 | 6n1t | e6n1tA1 | A:285-610 |
| Q07422 | DB03541 | CB3 | 6n1t | e6n1tB2 | B:285-610 |