Attributes
UniProt ID
Protein Name
Malate dehydrogenase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1HLP
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1hlpA2e1hlpA3e1hlpB1e1hlpB2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q07841 | DB14128 | NAD | 1hlp | e1hlpA2 | A:21-160 |
| Q07841 | DB14128 | NAD | 1hlp | e1hlpA3 | A:161-328 |
| Q07841 | DB14128 | NAD | 1hlp | e1hlpB1 | B:161-328 |
| Q07841 | DB14128 | NAD | 1hlp | e1hlpB2 | B:21-160 |
| Q07841 | DB14128 | NAD | 1o6z | e1o6zA1 | A:163-330 |
| Q07841 | DB14128 | NAD | 1o6z | e1o6zA2 | A:22-162 |
| Q07841 | DB14128 | NAD | 1o6z | e1o6zB1 | B:163-330 |
| Q07841 | DB14128 | NAD | 1o6z | e1o6zB2 | B:22-162 |
| Q07841 | DB14128 | NAD | 1o6z | e1o6zC2 | C:22-162 |
| Q07841 | DB14128 | NAD | 1o6z | e1o6zC3 | C:163-330 |
| Q07841 | DB14128 | NAD | 1o6z | e1o6zD1 | D:163-330 |
| Q07841 | DB14128 | NAD | 1o6z | e1o6zD2 | D:22-162 |
| Q07841 | DB14128 | NAD | 2x0r | e2x0rA2 | A:22-162 |
| Q07841 | DB14128 | NAD | 2x0r | e2x0rA3 | A:163-330 |
| Q07841 | DB14128 | NAD | 2x0r | e2x0rB2 | B:22-157 |
| Q07841 | DB14128 | NAD | 2x0r | e2x0rB3 | B:163-330 |