Attributes
UniProt ID
Protein Name
histidine kinase
Ligand Name
3-[5-[(Z)-(4-ethenyl-3-methyl-5-oxidanylidene-pyrrol-2-ylidene)methyl]-2-[[5-[(Z)-(3-ethenyl-4-methyl-5-oxidanylidene-pyrrol-2-ylidene)methyl]-3-(3-hydroxy-3-oxopropyl)-4-methyl-1H-pyrrol-2-yl]methyl]-4-methyl-1H-pyrrol-3-yl]propanoic acid
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BPYKTIZUTYGOLE-IFADSCNNSA-N
SMILES
Cc1c(c([nH]c1C=C2C(=C(C(=O)N2)C=C)C)Cc3c(c(c([nH]3)C=C4C(=C(C(=O)N4)C)C=C)C)CCC(=O)O)CCC(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6BAF
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6bafA1e6bafA2
ECOD domains from experimental PDB structures interacting with ligand BLR
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q097N3 | n/a | BLR | 6baf | e6bafA1 | A:132-318 |
| Q097N3 | n/a | BLR | 6baf | e6bafA2 | A:16-131 |
| Q097N3 | n/a | BLR | 6bak | e6bakA1 | A:16-131 |
| Q097N3 | n/a | BLR | 6bak | e6bakA2 | A:132-318 |
| Q097N3 | n/a | BLR | 6bao | e6baoA1 | A:11-133 |
| Q097N3 | n/a | BLR | 6bao | e6baoA2 | A:134-323 |
| Q097N3 | n/a | BLR | 6bao | e6baoA3 | A:324-513 |
| Q097N3 | n/a | BLR | 6bao | e6baoB1 | B:324-513 |
| Q097N3 | n/a | BLR | 6bao | e6baoB2 | B:11-133 |
| Q097N3 | n/a | BLR | 6bao | e6baoB3 | B:134-323 |
| Q097N3 | n/a | BLR | 6bap | e6bapA1 | A:134-323 |
| Q097N3 | n/a | BLR | 6bap | e6bapA2 | A:11-133 |
| Q097N3 | n/a | BLR | 6bap | e6bapA3 | A:324-515 |
| Q097N3 | n/a | BLR | 6bap | e6bapB1 | B:324-515 |
| Q097N3 | n/a | BLR | 6bap | e6bapB2 | B:11-133 |
| Q097N3 | n/a | BLR | 6bap | e6bapB3 | B:134-323 |
| Q097N3 | n/a | BLR | 6bap | e6bapC1 | C:134-323 |
| Q097N3 | n/a | BLR | 6bap | e6bapC2 | C:324-515 |
| Q097N3 | n/a | BLR | 6bap | e6bapC3 | C:16-133 |
| Q097N3 | n/a | BLR | 6bay | e6bayA1 | A:11-133 |
| Q097N3 | n/a | BLR | 6bay | e6bayA2 | A:134-323 |
| Q097N3 | n/a | BLR | 6bay | e6bayA3 | A:324-515 |
| Q097N3 | n/a | BLR | 6bay | e6bayB1 | B:134-323 |
| Q097N3 | n/a | BLR | 6bay | e6bayB2 | B:324-515 |
| Q097N3 | n/a | BLR | 6bay | e6bayB3 | B:11-133 |
| Q097N3 | n/a | BLR | 6bay | e6bayC1 | C:16-133 |
| Q097N3 | n/a | BLR | 6bay | e6bayC2 | C:134-323 |
| Q097N3 | n/a | BLR | 6bay | e6bayC3 | C:324-515 |