Attributes
UniProt ID
Protein Name
histidine kinase
Ligand Name
3-[(2Z)-2-({3-(2-carboxyethyl)-5-[(E)-(4-ethenyl-3-methyl-5-oxo-1,5-dihydro-2H-pyrrol-2-ylidene)methyl]-4-methyl-1H-pyrrol-2-yl}methylidene)-5-{(Z)-[(3E,4S)-3-ethylidene-4-methyl-5-oxopyrrolidin-2-ylidene]methyl}-4-methyl-2H-pyrrol-3-yl]propanoic acid
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SNHIGJASYQUMKZ-IDFYGOSVSA-N
SMILES
CC=C1C(C(=O)NC1=CC2=NC(=Cc3c(c(c([nH]3)C=C4C(=C(C(=O)N4)C=C)C)C)CCC(=O)O)C(=C2C)CCC(=O)O)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6PTQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6ptqA1e6ptqA2e6ptqA3e6ptqB1e6ptqB2e6ptqB3
ECOD domains from experimental PDB structures interacting with ligand EL5
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q09E27 | n/a | EL5 | 6ptq | e6ptqA1 | A:309-490 |
| Q09E27 | n/a | EL5 | 6ptq | e6ptqA2 | A:9-119 |
| Q09E27 | n/a | EL5 | 6ptq | e6ptqA3 | A:120-308 |
| Q09E27 | n/a | EL5 | 6ptq | e6ptqB1 | B:120-308 |
| Q09E27 | n/a | EL5 | 6ptq | e6ptqB2 | B:9-119 |
| Q09E27 | n/a | EL5 | 6ptq | e6ptqB3 | B:309-490 |
| Q09E27 | n/a | EL5 | 6ptx | e6ptxA1 | A:9-119 |
| Q09E27 | n/a | EL5 | 6ptx | e6ptxA2 | A:120-308 |
| Q09E27 | n/a | EL5 | 6ptx | e6ptxA3 | A:309-489 |
| Q09E27 | n/a | EL5 | 6ptx | e6ptxB1 | B:9-119 |
| Q09E27 | n/a | EL5 | 6ptx | e6ptxB2 | B:120-308 |
| Q09E27 | n/a | EL5 | 6ptx | e6ptxB3 | B:309-489 |
| Q09E27 | n/a | EL5 | 6pu2 | e6pu2A1 | A:120-308 |
| Q09E27 | n/a | EL5 | 6pu2 | e6pu2A2 | A:9-119 |
| Q09E27 | n/a | EL5 | 6pu2 | e6pu2A3 | A:309-489 |
| Q09E27 | n/a | EL5 | 6pu2 | e6pu2B1 | B:9-119 |
| Q09E27 | n/a | EL5 | 6pu2 | e6pu2B2 | B:120-308 |
| Q09E27 | n/a | EL5 | 6pu2 | e6pu2B3 | B:309-489 |