Attributes
UniProt ID
Protein Name
4-hydroxyproline betaine 2-epimerase -4-hydroxyproline betaine 2-epimerase
Ligand Name
(2S,4R)-4-hydroxy-1,1-dimethylpyrrolidinium-2-carboxylate
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MUNWAHDYFVYIKH-RITPCOANSA-N
SMILES
C[N+]1(CC(CC1C(=O)[O-])O)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4H2H
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4h2hA1e4h2hA2e4h2hB1e4h2hB2e4h2hC1e4h2hC2e4h2hD1e4h2hD2e4h2hE1e4h2hE2e4h2hF1e4h2hF2e4h2hG1e4h2hG2e4h2hH1e4h2hH2
ECOD domains from experimental PDB structures interacting with ligand 0XW
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hA1 | A:0-116 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hA2 | A:117-367 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hB1 | B:-8-108 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hB2 | B:109-359 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hC1 | C:-8-108 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hC2 | C:109-359 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hD1 | D:-8-108 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hD2 | D:109-359 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hE1 | E:-8-108 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hE2 | E:109-359 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hF1 | F:-8-108 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hF2 | F:109-359 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hG1 | G:-8-108 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hG2 | G:109-359 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hH1 | H:-8-108 |
| Q0FPQ4 | n/a | 0XW | 4h2h | e4h2hH2 | H:109-359 |