Attributes
UniProt ID
Protein Name
Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3E5R
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3e5rA1e3e5rA2e3e5rB1e3e5rB2e3e5rC1e3e5rC2e3e5rO1e3e5rO2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q0J8A4 | DB14128 | NAD | 3e5r | e3e5rA1 | A:154-317 |
| Q0J8A4 | DB14128 | NAD | 3e5r | e3e5rA2 | A:2-153,A:318-337 |
| Q0J8A4 | DB14128 | NAD | 3e5r | e3e5rB1 | B:154-317 |
| Q0J8A4 | DB14128 | NAD | 3e5r | e3e5rB2 | B:2-153,B:318-337 |
| Q0J8A4 | DB14128 | NAD | 3e5r | e3e5rC1 | C:154-317 |
| Q0J8A4 | DB14128 | NAD | 3e5r | e3e5rC2 | C:2-153,C:318-337 |
| Q0J8A4 | DB14128 | NAD | 3e5r | e3e5rO1 | O:154-317 |
| Q0J8A4 | DB14128 | NAD | 3e5r | e3e5rO2 | O:2-153,O:318-337 |
| Q0J8A4 | DB14128 | NAD | 3v1y | e3v1yA1 | A:152-315 |
| Q0J8A4 | DB14128 | NAD | 3v1y | e3v1yA2 | A:1-151,A:316-335 |
| Q0J8A4 | DB14128 | NAD | 3v1y | e3v1yB1 | B:153-316 |
| Q0J8A4 | DB14128 | NAD | 3v1y | e3v1yB2 | B:1-152,B:317-336 |
| Q0J8A4 | DB14128 | NAD | 3v1y | e3v1yC1 | C:153-316 |
| Q0J8A4 | DB14128 | NAD | 3v1y | e3v1yC2 | C:1-152,C:317-336 |
| Q0J8A4 | DB14128 | NAD | 3v1y | e3v1yO1 | O:154-317 |
| Q0J8A4 | DB14128 | NAD | 3v1y | e3v1yO2 | O:2-153,O:318-337 |