Attributes
UniProt ID
Protein Name
3-Hydroxyacyl-CoA dehydrogenase
Ligand Name
ACETOACETYL-COENZYME A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OJFDKHTZOUZBOS-CITAKDKDSA-N
SMILES
CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4PZE
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4pzeA1e4pzeA2e4pzeB1e4pzeB2e4pzeC1e4pzeC2e4pzeD1e4pzeD2e4pzeE1e4pzeE2e4pzeF1e4pzeF2e4pzeG1e4pzeG2e4pzeH1e4pzeH2e4pzeI1e4pzeI2
ECOD domains from experimental PDB structures interacting with ligand DB03059
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeA1 | A:186-284 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeA2 | A:2-185 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeB1 | B:2-185 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeB2 | B:186-284 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeC1 | C:2-185 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeC2 | C:186-284 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeD1 | D:186-284 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeD2 | D:2-185 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeE1 | E:2-185 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeE2 | E:186-284 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeF1 | F:2-185 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeF2 | F:186-284 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeG1 | G:186-284 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeG2 | G:2-185 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeH1 | H:186-284 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeH2 | H:2-185 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeI1 | I:2-185 |
| Q0KEY8 | DB03059 | CAA | 4pze | e4pzeI2 | I:186-284 |