Attributes
UniProt ID
Protein Name
FAD dependent oxidoreductase domain-containing protein
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5T1E
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5t1eA1e5t1eA2
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q0UIL6 | DB03147 | FAD | 5t1e | e5t1eA1 | A:1-228 |
| Q0UIL6 | DB03147 | FAD | 5t1e | e5t1eA2 | A:229-431 |
| Q0UIL6 | DB03147 | FAD | 5t1f | e5t1fA1 | A:1-228 |
| Q0UIL6 | DB03147 | FAD | 5t1f | e5t1fA2 | A:229-431 |
| Q0UIL6 | DB03147 | FAD | 5xao | e5xaoA1 | A:1-228 |
| Q0UIL6 | DB03147 | FAD | 5xao | e5xaoA2 | A:229-431 |
| Q0UIL6 | DB03147 | FAD | 5xao | e5xaoC1 | C:229-431 |
| Q0UIL6 | DB03147 | FAD | 5xao | e5xaoC2 | C:1-228 |
| Q0UIL6 | DB03147 | FAD | 8bjy | e8bjyA1 | A:224-427 |
| Q0UIL6 | DB03147 | FAD | 8bjy | e8bjyA2 | A:1-223 |
| Q0UIL6 | DB03147 | FAD | 8blx | e8blxA1 | A:2-223 |
| Q0UIL6 | DB03147 | FAD | 8blx | e8blxA2 | A:224-426 |
| Q0UIL6 | DB03147 | FAD | 8blz | e8blzC1 | C:224-426 |
| Q0UIL6 | DB03147 | FAD | 8blz | e8blzC2 | C:3-223 |
| Q0UIL6 | DB03147 | FAD | 8bmu | e8bmuA1 | A:2-223 |
| Q0UIL6 | DB03147 | FAD | 8bmu | e8bmuA2 | A:224-427 |