Attributes
UniProt ID
Protein Name
Polypeptide N-acetylgalactosaminyltransferase 2
Ligand Name
URIDINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XCCTYIAWTASOJW-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2FFU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2ffuA1e2ffuA2
ECOD domains from experimental PDB structures interacting with ligand DB03435
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q10471 | DB03435 | UDP | 2ffu | e2ffuA2 | A:75-435 |
| Q10471 | DB03435 | UDP | 2ffv | e2ffvA2 | A:72-437 |
| Q10471 | DB03435 | UDP | 2ffv | e2ffvB4 | B:74-437 |
| Q10471 | DB03435 | UDP | 4d0t | e4d0tC3 | C:75-423 |
| Q10471 | DB03435 | UDP | 4d11 | e4d11A3 | A:75-423 |
| Q10471 | DB03435 | UDP | 4d11 | e4d11B1 | B:75-423 |
| Q10471 | DB03435 | UDP | 4d11 | e4d11C1 | C:74-437 |
| Q10471 | DB03435 | UDP | 4d11 | e4d11D3 | D:75-423 |
| Q10471 | DB03435 | UDP | 4d11 | e4d11E3 | E:75-423 |
| Q10471 | DB03435 | UDP | 4d11 | e4d11F1 | F:76-362 |
| Q10471 | DB03435 | UDP | 5ajp | e5ajpA1 | A:75-437 |
| Q10471 | DB03435 | UDP | 5fv9 | e5fv9A1 | A:75-423 |
| Q10471 | DB03435 | UDP | 5fv9 | e5fv9B1 | B:75-423 |
| Q10471 | DB03435 | UDP | 5fv9 | e5fv9C1 | C:75-423 |
| Q10471 | DB03435 | UDP | 5fv9 | e5fv9D2 | D:75-423 |
| Q10471 | DB03435 | UDP | 5fv9 | e5fv9E2 | E:75-423 |
| Q10471 | DB03435 | UDP | 5fv9 | e5fv9F1 | F:75-423 |
| Q10471 | DB03435 | UDP | 5ndf | e5ndfA1 | A:75-423 |
| Q10471 | DB03435 | UDP | 5ndf | e5ndfB1 | B:75-423 |
| Q10471 | DB03435 | UDP | 5ndf | e5ndfC2 | C:75-423 |
| Q10471 | DB03435 | UDP | 5ndf | e5ndfD2 | D:75-423 |
| Q10471 | DB03435 | UDP | 5ndf | e5ndfE2 | E:75-429 |
| Q10471 | DB03435 | UDP | 5ndf | e5ndfF2 | F:75-423 |
| Q10471 | DB03435 | UDP | 6e7i | e6e7iA3 | A:75-437 |