Attributes
UniProt ID
Protein Name
Calcium-activated potassium channel subunit alpha-1 alpha
Ligand Name
CHOLESTEROL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HVYWMOMLDIMFJA-DPAQBDIFSA-N
SMILES
CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6V22
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6v22A1e6v22A2e6v22A3e6v22A4e6v22A5e6v22B1e6v22B2e6v22B3e6v22B4e6v22B5e6v22C1e6v22C2e6v22C3e6v22C4e6v22C5e6v22D1e6v22D2e6v22D3e6v22D4e6v22D5
ECOD domains from experimental PDB structures interacting with ligand DB04540
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q12791 | DB04540 | CLR | 6v22 | e6v22A1 | A:16-49,A:91-331 |
| Q12791 | DB04540 | CLR | 6v22 | e6v22B2 | B:16-49,B:91-331 |
| Q12791 | DB04540 | CLR | 6v22 | e6v22C4 | C:16-49,C:91-331 |
| Q12791 | DB04540 | CLR | 6v22 | e6v22D2 | D:16-49,D:91-331 |
| Q12791 | DB04540 | CLR | 6v35 | e6v35A2 | A:19-53,A:93-331 |
| Q12791 | DB04540 | CLR | 6v35 | e6v35B1 | B:19-53,B:93-331 |
| Q12791 | DB04540 | CLR | 6v35 | e6v35C3 | C:19-53,C:93-331 |
| Q12791 | DB04540 | CLR | 6v35 | e6v35D2 | D:19-53,D:93-331 |
| Q12791 | DB04540 | CLR | 6v38 | e6v38A4 | A:19-51,A:93-331 |
| Q12791 | DB04540 | CLR | 6v38 | e6v38B4 | B:19-51,B:93-331 |
| Q12791 | DB04540 | CLR | 6v38 | e6v38C1 | C:19-51,C:93-331 |
| Q12791 | DB04540 | CLR | 6v38 | e6v38D4 | D:19-51,D:93-331 |
| Q12791 | DB04540 | CLR | 8ghf | e8ghfA4 | A:19-49,A:91-331 |
| Q12791 | DB04540 | CLR | 8ghf | e8ghfB2 | B:19-49,B:91-331 |
| Q12791 | DB04540 | CLR | 8ghf | e8ghfC4 | C:19-49,C:91-331 |
| Q12791 | DB04540 | CLR | 8ghf | e8ghfD2 | D:19-49,D:91-331 |