Attributes
UniProt ID
Protein Name
Putative nucleotidyltransferase MAB21L1
Ligand Name
CYTIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PCDQPRRSZKQHHS-XVFCMESISA-N
SMILES
C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5EOM
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5eomA1e5eomA2e5eomB1e5eomB2e5eomC1e5eomC2e5eomD1e5eomD2e5eomE1e5eomE2e5eomF1e5eomF2e5eomG1e5eomG2e5eomH1e5eomH2e5eomI1e5eomI2e5eomJ1e5eomJ2
ECOD domains from experimental PDB structures interacting with ligand DB02431
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q13394 | DB02431 | CTP | 5eom | e5eomA1 | A:242-359 |
| Q13394 | DB02431 | CTP | 5eom | e5eomA2 | A:1-241 |
| Q13394 | DB02431 | CTP | 5eom | e5eomB1 | B:242-359 |
| Q13394 | DB02431 | CTP | 5eom | e5eomB2 | B:-2-241 |
| Q13394 | DB02431 | CTP | 5eom | e5eomC1 | C:-2-241 |
| Q13394 | DB02431 | CTP | 5eom | e5eomC2 | C:242-359 |
| Q13394 | DB02431 | CTP | 5eom | e5eomD1 | D:-1-241 |
| Q13394 | DB02431 | CTP | 5eom | e5eomD2 | D:242-359 |
| Q13394 | DB02431 | CTP | 5eom | e5eomE1 | E:1-241 |
| Q13394 | DB02431 | CTP | 5eom | e5eomE2 | E:242-359 |
| Q13394 | DB02431 | CTP | 5eom | e5eomF1 | F:-2-241 |
| Q13394 | DB02431 | CTP | 5eom | e5eomF2 | F:242-359 |
| Q13394 | DB02431 | CTP | 5eom | e5eomG1 | G:242-359 |
| Q13394 | DB02431 | CTP | 5eom | e5eomG2 | G:-2-241 |
| Q13394 | DB02431 | CTP | 5eom | e5eomH1 | H:-2-241 |
| Q13394 | DB02431 | CTP | 5eom | e5eomH2 | H:242-359 |
| Q13394 | DB02431 | CTP | 5eom | e5eomI1 | I:242-359 |
| Q13394 | DB02431 | CTP | 5eom | e5eomI2 | I:1-241 |
| Q13394 | DB02431 | CTP | 5eom | e5eomJ1 | J:-1-241 |
| Q13394 | DB02431 | CTP | 5eom | e5eomJ2 | J:242-359 |