Attributes
UniProt ID
Protein Name
GDP-L-fucose synthase -binding protein
Ligand Name
NADP NICOTINAMIDE-ADENINE-DINUCLEOTIDE PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XJLXINKUBYWONI-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)OP(=O)(O)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4B8W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4b8wA1e4b8wB1
ECOD domains from experimental PDB structures interacting with ligand DB03461
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q13630 | DB03461 | NAP | 4b8w | e4b8wA1 | A:-6-320 |
| Q13630 | DB03461 | NAP | 4b8w | e4b8wB1 | B:-6-301 |
| Q13630 | DB03461 | NAP | 4b8z | e4b8zA1 | A:-7-308 |
| Q13630 | DB03461 | NAP | 4b8z | e4b8zB1 | B:-7-320 |
| Q13630 | DB03461 | NAP | 4b8z | e4b8zC1 | C:-7-313 |
| Q13630 | DB03461 | NAP | 4b8z | e4b8zD1 | D:-7-313 |
| Q13630 | DB03461 | NAP | 4bkp | e4bkpA1 | A:-11-320 |
| Q13630 | DB03461 | NAP | 4bkp | e4bkpB1 | B:-11-320 |
| Q13630 | DB03461 | NAP | 4bkp | e4bkpC1 | C:-12-321 |
| Q13630 | DB03461 | NAP | 4bkp | e4bkpD1 | D:-7-320 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5A1 | A:-1-320 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5B1 | B:-6-321 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5C1 | C:-7-321 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5D1 | D:-1-321 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5E1 | E:-7-320 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5F1 | F:8-320 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5G1 | G:-7-320 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5H1 | H:-1-321 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5I1 | I:-7-321 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5J1 | J:8-320 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5K1 | K:8-320 |
| Q13630 | DB03461 | NAP | 4bl5 | e4bl5L1 | L:-7-320 |