Attributes
UniProt ID
Protein Name
Trehalose-6-phosphate synthase
Ligand Name
URIDINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XCCTYIAWTASOJW-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5V0T
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5v0tA1e5v0tA2e5v0tB1e5v0tB2e5v0tC1e5v0tC2e5v0tD1e5v0tD2e5v0tE1e5v0tE2e5v0tF1e5v0tF2e5v0tG1e5v0tG2e5v0tH1e5v0tH2
ECOD domains from experimental PDB structures interacting with ligand DB03435
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tA1 | A:239-467 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tA2 | A:10-238 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tB1 | B:10-238 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tB2 | B:239-467 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tC1 | C:10-238 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tC2 | C:239-467 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tD1 | D:239-467 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tD2 | D:10-238 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tE1 | E:10-238 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tE2 | E:239-466 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tF1 | F:239-467 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tF2 | F:10-238 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tG1 | G:239-467 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tG2 | G:10-238 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tH1 | H:239-467 |
| Q13W28 | DB03435 | UDP | 5v0t | e5v0tH2 | H:11-238 |