Attributes
UniProt ID
Protein Name
ATP-dependent RNA helicase DHX8
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6HYS
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6hysA1e6hysA2e6hysA3e6hysA4e6hysB1e6hysB2e6hysB3e6hysB4e6hysC1e6hysC2e6hysC3e6hysC4e6hysD1e6hysD2e6hysD3e6hysD4
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q14562 | DB16833 | ADP | 6hys | e6hysA1 | A:740-915 |
| Q14562 | DB16833 | ADP | 6hys | e6hysA4 | A:555-739 |
| Q14562 | DB16833 | ADP | 6hys | e6hysB1 | B:555-739 |
| Q14562 | DB16833 | ADP | 6hys | e6hysB3 | B:740-915 |
| Q14562 | DB16833 | ADP | 6hys | e6hysC1 | C:556-739 |
| Q14562 | DB16833 | ADP | 6hys | e6hysC4 | C:740-915 |
| Q14562 | DB16833 | ADP | 6hys | e6hysD2 | D:740-915 |
| Q14562 | DB16833 | ADP | 6hys | e6hysD4 | D:556-739 |
| Q14562 | DB16833 | ADP | 6hyt | e6hytA2 | A:740-915 |
| Q14562 | DB16833 | ADP | 6hyt | e6hytA4 | A:555-739 |
| Q14562 | DB16833 | ADP | 6hyt | e6hytB3 | B:740-915 |
| Q14562 | DB16833 | ADP | 6hyt | e6hytB4 | B:556-739 |
| Q14562 | DB16833 | ADP | 6hyt | e6hytC1 | C:556-739 |
| Q14562 | DB16833 | ADP | 6hyt | e6hytC4 | C:740-915 |
| Q14562 | DB16833 | ADP | 6hyt | e6hytD2 | D:556-739 |
| Q14562 | DB16833 | ADP | 6hyt | e6hytD4 | D:740-915 |