Attributes
UniProt ID
Protein Name
ATP-sensitive inward rectifier potassium channel 11 channel Kir6.2
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6C3O
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6c3oA1e6c3oA2e6c3oB1e6c3oB2e6c3oC1e6c3oC2e6c3oD1e6c3oD2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q14654 | DB00171 | ATP | 6c3o | e6c3oA1 | A:32-175 |
| Q14654 | DB00171 | ATP | 6c3o | e6c3oA2 | A:173-359 |
| Q14654 | DB00171 | ATP | 6c3o | e6c3oB1 | B:32-175 |
| Q14654 | DB00171 | ATP | 6c3o | e6c3oB2 | B:173-359 |
| Q14654 | DB00171 | ATP | 6c3o | e6c3oC1 | C:173-359 |
| Q14654 | DB00171 | ATP | 6c3o | e6c3oC2 | C:32-175 |
| Q14654 | DB00171 | ATP | 6c3o | e6c3oD1 | D:32-175 |
| Q14654 | DB00171 | ATP | 6c3o | e6c3oD2 | D:173-359 |
| Q14654 | DB00171 | ATP | 6c3p | e6c3pA2 | A:32-175 |
| Q14654 | DB00171 | ATP | 6c3p | e6c3pB1 | B:32-175 |
| Q14654 | DB00171 | ATP | 6c3p | e6c3pB2 | B:173-359 |
| Q14654 | DB00171 | ATP | 6c3p | e6c3pC1 | C:173-359 |
| Q14654 | DB00171 | ATP | 6c3p | e6c3pC2 | C:32-175 |
| Q14654 | DB00171 | ATP | 6c3p | e6c3pD1 | D:32-175 |
| Q14654 | DB00171 | ATP | 6c3p | e6c3pD2 | D:173-359 |