Attributes
UniProt ID
Protein Name
116 kDa U5 small nuclear ribonucleoprotein component
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5XJC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5xjcA1e5xjcA2e5xjcA3e5xjcA4e5xjcA5e5xjcA6e5xjcC1e5xjcC2e5xjcC3e5xjcC4e5xjcC5e5xjcD1e5xjcD10e5xjcD11e5xjcD12e5xjcD2e5xjcD3e5xjcD4e5xjcD5e5xjcD6e5xjcD7e5xjcD8e5xjcD9e5xjcE1e5xjcI1e5xjcJ1e5xjcN1e5xjcO1e5xjcO2e5xjcO3e5xjcQ1e5xjcQ2e5xjcQ3e5xjcQ4e5xjcQ5e5xjcS1e5xjcT1e5xjcV1e5xjcV2e5xjcW1e5xjcZ1e5xjcZ2e5xjca1e5xjcb1e5xjcc1e5xjcd1e5xjce1e5xjcf1e5xjcg1e5xjch1e5xjci1e5xjcj1e5xjck1e5xjcl1e5xjcm1e5xjcn1e5xjco1e5xjcp1e5xjcu1e5xjcu2e5xjcv1e5xjcw1
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q15029 | DB04137 | GTP | 5xjc | e5xjcC3 | C:56-439 |
| Q15029 | DB04137 | GTP | 6ah0 | e6ah0C2 | C:112-439 |
| Q15029 | DB04137 | GTP | 6ahd | e6ahdC3 | C:112-439 |
| Q15029 | DB04137 | GTP | 6ff4 | e6ff4B2 | B:56-439 |
| Q15029 | DB04137 | GTP | 6icz | e6iczC2 | C:56-439 |
| Q15029 | DB04137 | GTP | 6id0 | e6id0C2 | C:56-439 |
| Q15029 | DB04137 | GTP | 6id1 | e6id1C4 | C:56-439 |
| Q15029 | DB04137 | GTP | 6qdv | e6qdvC4 | C:56-439 |
| Q15029 | DB04137 | GTP | 6qw6 | e6qw65C2 | 5C:105-439 |
| Q15029 | DB04137 | GTP | 6qx9 | e6qx95C3 | 5C:105-439 |
| Q15029 | DB04137 | GTP | 6zym | e6zymB1 | B:58-439 |
| Q15029 | DB04137 | GTP | 7aav | e7aavr1 | r:63-439 |
| Q15029 | DB04137 | GTP | 7abf | e7abfr5 | r:114-439 |
| Q15029 | DB04137 | GTP | 7abg | e7abgr4 | r:114-439 |
| Q15029 | DB04137 | GTP | 7abi | e7abir5 | r:63-439 |
| Q15029 | DB04137 | GTP | 7dvq | e7dvqC5 | C:56-439 |
| Q15029 | DB04137 | GTP | 7qtt | e7qttb5 | b:55-439 |
| Q15029 | DB04137 | GTP | 7w59 | e7w59C2 | C:56-439 |
| Q15029 | DB04137 | GTP | 7w5a | e7w5aC2 | C:56-439 |
| Q15029 | DB04137 | GTP | 7w5b | e7w5bC1 | C:56-439 |
| Q15029 | DB04137 | GTP | 8c6j | e8c6jC2 | C:56-439 |
| Q15029 | DB04137 | GTP | 8ch6 | e8ch6b1 | b:55-439 |