Attributes
UniProt ID
Protein Name
Receptor tyrosine-protein kinase erbB-4
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2AHX
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2ahxA1e2ahxA3e2ahxA4e2ahxA5e2ahxB2e2ahxB3e2ahxB4e2ahxB5
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q15303 | DB00141 | NAG | 2ahx | e2ahxA1 | A:477-616 |
| Q15303 | DB00141 | NAG | 2ahx | e2ahxB5 | B:477-614 |
| Q15303 | DB00141 | NAG | 3u2p | e3u2pA2 | A:307-497 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uA1 | A:309-476 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uA3 | A:477-556 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uA4 | A:1-153 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uB1 | B:477-612 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uC2 | C:149-305 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uC4 | C:1-148 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uD3 | D:311-476 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uD4 | D:1-153 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uD5 | D:477-614 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uE2 | E:477-608 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uE3 | E:311-476 |
| Q15303 | DB00141 | NAG | 3u7u | e3u7uF3 | F:477-610 |