Attributes
UniProt ID
Protein Name
GTP-binding protein Rheb
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1XTQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1xtqA1
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q15382 | DB04315 | GDP | 1xtq | e1xtqA1 | A:3-169 |
| Q15382 | DB04315 | GDP | 3sea | e3seaA1 | A:3-169 |
| Q15382 | DB04315 | GDP | 3t5g | e3t5gA1 | A:2-181 |
| Q15382 | DB04315 | GDP | 5yxh | e5yxhA1 | A:3-171 |
| Q15382 | DB04315 | GDP | 5yxh | e5yxhB1 | B:3-171 |
| Q15382 | DB04315 | GDP | 5yxh | e5yxhC1 | C:3-171 |
| Q15382 | DB04315 | GDP | 5yxh | e5yxhD1 | D:3-171 |
| Q15382 | DB04315 | GDP | 6bsx | e6bsxA1 | A:2-171 |
| Q15382 | DB04315 | GDP | 6bsx | e6bsxB1 | B:2-171 |
| Q15382 | DB04315 | GDP | 6bsx | e6bsxC1 | C:2-171 |
| Q15382 | DB04315 | GDP | 6bsx | e6bsxD1 | D:2-171 |
| Q15382 | DB04315 | GDP | 6bt0 | e6bt0A1 | A:3-171 |
| Q15382 | DB04315 | GDP | 6bt0 | e6bt0B1 | B:3-170 |
| Q15382 | DB04315 | GDP | 6bt0 | e6bt0C1 | C:3-170 |
| Q15382 | DB04315 | GDP | 6bt0 | e6bt0D1 | D:3-170 |
| Q15382 | DB04315 | GDP | 7bta | e7btaA1 | A:4-170 |
| Q15382 | DB04315 | GDP | 7bta | e7btaB1 | B:4-170 |
| Q15382 | DB04315 | GDP | 7btc | e7btcA1 | A:3-170 |
| Q15382 | DB04315 | GDP | 7btc | e7btcB1 | B:3-171 |
| Q15382 | DB04315 | GDP | 7btc | e7btcC1 | C:2-170 |
| Q15382 | DB04315 | GDP | 7btc | e7btcD1 | D:4-171 |