Attributes
UniProt ID
Protein Name
Pachytene checkpoint protein 2 homolog
Ligand Name
PHOSPHOTHIOPHOSPHORIC ACID-ADENYLATE ESTER
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NLTUCYMLOPLUHL-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=S)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6F0X
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6f0xA1e6f0xA2e6f0xB1e6f0xB2e6f0xB3e6f0xC1e6f0xC2e6f0xC3e6f0xD1e6f0xD2e6f0xD3e6f0xE1e6f0xE2e6f0xE3e6f0xF1e6f0xF2e6f0xP1e6f0xZ1
ECOD domains from experimental PDB structures interacting with ligand DB02930
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q15645 | DB02930 | AGS | 6f0x | e6f0xA1 | A:122-320 |
| Q15645 | DB02930 | AGS | 6f0x | e6f0xA2 | A:321-429 |
| Q15645 | DB02930 | AGS | 6f0x | e6f0xB2 | B:108-320 |
| Q15645 | DB02930 | AGS | 6f0x | e6f0xB3 | B:321-429 |
| Q15645 | DB02930 | AGS | 6f0x | e6f0xC1 | C:321-429 |
| Q15645 | DB02930 | AGS | 6f0x | e6f0xC2 | C:108-320 |
| Q15645 | DB02930 | AGS | 6f0x | e6f0xD1 | D:321-429 |
| Q15645 | DB02930 | AGS | 6f0x | e6f0xD2 | D:108-320 |
| Q15645 | DB02930 | AGS | 6f0x | e6f0xE1 | E:108-320 |
| Q15645 | DB02930 | AGS | 6f0x | e6f0xE3 | E:321-429 |
| Q15645 | DB02930 | AGS | 6f0x | e6f0xF1 | F:122-320 |
| Q15645 | DB02930 | AGS | 7l9p | e7l9pA1 | A:122-320 |
| Q15645 | DB02930 | AGS | 7l9p | e7l9pA2 | A:321-429 |
| Q15645 | DB02930 | AGS | 7l9p | e7l9pB1 | B:321-429 |
| Q15645 | DB02930 | AGS | 7l9p | e7l9pB2 | B:108-320 |
| Q15645 | DB02930 | AGS | 7l9p | e7l9pC1 | C:108-320 |
| Q15645 | DB02930 | AGS | 7l9p | e7l9pC2 | C:321-429 |
| Q15645 | DB02930 | AGS | 7l9p | e7l9pD2 | D:108-320 |
| Q15645 | DB02930 | AGS | 7l9p | e7l9pD3 | D:321-429 |
| Q15645 | DB02930 | AGS | 7l9p | e7l9pE1 | E:321-429 |
| Q15645 | DB02930 | AGS | 7l9p | e7l9pE2 | E:108-320 |
| Q15645 | DB02930 | AGS | 7l9p | e7l9pF2 | F:122-320 |