Attributes
UniProt ID
Protein Name
Validamine 7-phosphate valienyltransferase
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3VDN
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3vdnB1e3vdnB2
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q15JG1 | DB04315 | GDP | 3vdn | e3vdnB2 | B:257-481 |
| Q15JG1 | DB04315 | GDP | 4f96 | e4f96A2 | A:257-481 |
| Q15JG1 | DB04315 | GDP | 4f96 | e4f96B2 | B:257-481 |
| Q15JG1 | DB04315 | GDP | 4f97 | e4f97A2 | A:257-479 |
| Q15JG1 | DB04315 | GDP | 4f97 | e4f97B2 | B:257-481 |
| Q15JG1 | DB04315 | GDP | 4f9f | e4f9fA2 | A:257-477 |
| Q15JG1 | DB04315 | GDP | 4f9f | e4f9fB1 | B:5-256 |
| Q15JG1 | DB04315 | GDP | 4f9f | e4f9fB2 | B:257-478 |
| Q15JG1 | DB04315 | GDP | 4f9f | e4f9fC1 | C:4-256 |
| Q15JG1 | DB04315 | GDP | 4f9f | e4f9fC2 | C:257-480 |
| Q15JG1 | DB04315 | GDP | 4f9f | e4f9fD1 | D:257-478 |
| Q15JG1 | DB04315 | GDP | 4f9f | e4f9fE1 | E:4-256 |
| Q15JG1 | DB04315 | GDP | 4f9f | e4f9fE2 | E:257-479 |
| Q15JG1 | DB04315 | GDP | 4f9f | e4f9fF1 | F:4-256 |
| Q15JG1 | DB04315 | GDP | 4f9f | e4f9fF2 | F:257-479 |