Attributes
UniProt ID
Protein Name
Meprin A subunit beta
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4GWM
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4gwmA1e4gwmA2e4gwmA4e4gwmB10e4gwmB11e4gwmB12
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q16820 | DB00141 | NAG | 4gwm | e4gwmA1 | A:25-259 |
| Q16820 | DB00141 | NAG | 4gwm | e4gwmA2 | A:260-428 |
| Q16820 | DB00141 | NAG | 4gwm | e4gwmA4 | A:426-597 |
| Q16820 | DB00141 | NAG | 4gwm | e4gwmB10 | B:23-259 |
| Q16820 | DB00141 | NAG | 4gwm | e4gwmB12 | B:426-593 |
| Q16820 | DB00141 | NAG | 4gwn | e4gwnA7 | A:62-259 |
| Q16820 | DB00141 | NAG | 4gwn | e4gwnA8 | A:260-428 |
| Q16820 | DB00141 | NAG | 4gwn | e4gwnA9 | A:425-594 |
| Q16820 | DB00141 | NAG | 7aq1 | e7aq1A2 | A:62-259 |
| Q16820 | DB00141 | NAG | 7aq1 | e7aq1A3 | A:425-594 |
| Q16820 | DB00141 | NAG | 7aq1 | e7aq1B1 | B:425-594 |
| Q16820 | DB00141 | NAG | 7aq1 | e7aq1B2 | B:62-259 |
| Q16820 | DB00141 | NAG | 7auw | e7auwA2 | A:425-593 |
| Q16820 | DB00141 | NAG | 7auw | e7auwA3 | A:62-259 |
| Q16820 | DB00141 | NAG | 7auw | e7auwC1 | C:62-259 |
| Q16820 | DB00141 | NAG | 7auw | e7auwC2 | C:260-428 |
| Q16820 | DB00141 | NAG | 7auw | e7auwC3 | C:425-593 |