Attributes
UniProt ID
Protein Name
Lanosterol 14-alpha demethylase
Ligand Name
PROTOPORPHYRIN IX CONTAINING FE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES
Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3JUS
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3jusA1e3jusB1
ECOD domains from experimental PDB structures interacting with ligand DB18267
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q16850 | DB18267 | HEM | 3jus | e3jusA1 | A:58-502 |
| Q16850 | DB18267 | HEM | 3jus | e3jusB1 | B:58-502 |
| Q16850 | DB18267 | HEM | 3juv | e3juvA1 | A:55-502 |
| Q16850 | DB18267 | HEM | 3ld6 | e3ld6A1 | A:58-502 |
| Q16850 | DB18267 | HEM | 3ld6 | e3ld6B1 | B:58-501 |
| Q16850 | DB18267 | HEM | 4uhi | e4uhiA1 | A:61-502 |
| Q16850 | DB18267 | HEM | 4uhi | e4uhiB1 | B:61-502 |
| Q16850 | DB18267 | HEM | 4uhi | e4uhiC1 | C:61-502 |
| Q16850 | DB18267 | HEM | 4uhi | e4uhiD1 | D:61-502 |
| Q16850 | DB18267 | HEM | 4uhl | e4uhlA1 | A:58-502 |
| Q16850 | DB18267 | HEM | 4uhl | e4uhlB1 | B:58-502 |
| Q16850 | DB18267 | HEM | 4uhl | e4uhlC1 | C:58-502 |
| Q16850 | DB18267 | HEM | 4uhl | e4uhlD1 | D:58-502 |
| Q16850 | DB18267 | HEM | 4uhl | e4uhlE1 | E:58-502 |
| Q16850 | DB18267 | HEM | 4uhl | e4uhlF1 | F:58-502 |
| Q16850 | DB18267 | HEM | 4uhl | e4uhlG1 | G:58-502 |
| Q16850 | DB18267 | HEM | 4uhl | e4uhlH1 | H:58-502 |
| Q16850 | DB18267 | HEM | 6q2t | e6q2tA1 | A:58-502 |
| Q16850 | DB18267 | HEM | 6q2t | e6q2tB1 | B:59-502 |
| Q16850 | DB18267 | HEM | 6uez | e6uezA1 | A:57-502 |
| Q16850 | DB18267 | HEM | 6uez | e6uezB1 | B:58-502 |
| Q16850 | DB18267 | HEM | 8sbi | e8sbiA1 | A:58-502 |
| Q16850 | DB18267 | HEM | 8sbi | e8sbiB1 | B:58-502 |