Attributes
UniProt ID
Protein Name
Type IV pilus biogenesis protein PilM
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3JC9
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3jc9Aa1e3jc9Ab1e3jc9Ac1e3jc9Ad1e3jc9Ae1e3jc9Ca1e3jc9Ca2e3jc9Cb1e3jc9Cb2e3jc9Ma1e3jc9Ma2e3jc9Mb1e3jc9Mb2e3jc9Mc1e3jc9Mc2e3jc9Md1e3jc9Md2e3jc9Me1e3jc9Me2e3jc9Mf1e3jc9Mf2e3jc9Mg1e3jc9Mg2e3jc9Mh1e3jc9Mh2e3jc9Mi1e3jc9Mi2e3jc9Mj1e3jc9Mj2e3jc9Mk1e3jc9Mk2e3jc9Ml1e3jc9Ml2e3jc9Na1e3jc9Nb1e3jc9Nc1e3jc9Nd1e3jc9Ne1e3jc9Nf1e3jc9Ng1e3jc9Nh1e3jc9Ni1e3jc9Nj1e3jc9Nk1e3jc9Nl1e3jc9Oa1e3jc9Oa2e3jc9Ob1e3jc9Ob2e3jc9Oc1e3jc9Oc2e3jc9Od1e3jc9Od2e3jc9Oe1e3jc9Oe2e3jc9Of1e3jc9Of2e3jc9Og1e3jc9Og2e3jc9Oh1e3jc9Oh2e3jc9Oi1e3jc9Oi2e3jc9Oj1e3jc9Oj2e3jc9Ok1e3jc9Ok2e3jc9Ol1e3jc9Ol2e3jc9Pa1e3jc9Pb1e3jc9Pc1e3jc9Pd1e3jc9Pe1e3jc9Pf1e3jc9Pg1e3jc9Ph1e3jc9Pi1e3jc9Pj1e3jc9Pk1e3jc9Pl1e3jc9Qa1e3jc9Qa2e3jc9Qa3e3jc9Qa4e3jc9Qb1e3jc9Qb2e3jc9Qb3e3jc9Qb4e3jc9Qc1e3jc9Qc2e3jc9Qc3e3jc9Qc4e3jc9Qd1e3jc9Qd2e3jc9Qd3e3jc9Qd4e3jc9Qe1e3jc9Qe2e3jc9Qe3e3jc9Qe4e3jc9Qf1e3jc9Qf2e3jc9Qf3e3jc9Qf4e3jc9Qg1e3jc9Qg2e3jc9Qg3e3jc9Qg4e3jc9Qh1e3jc9Qh2e3jc9Qh3e3jc9Qh4e3jc9Qi1e3jc9Qi2e3jc9Qi3e3jc9Qi4e3jc9Qj1e3jc9Qj2e3jc9Qj3e3jc9Qj4e3jc9Qk1e3jc9Qk2e3jc9Qk3e3jc9Qk4e3jc9Ql1e3jc9Ql2e3jc9Ql3e3jc9Ql4e3jc9Ta1e3jc9Ta2e3jc9Tb1e3jc9Tb2e3jc9Tc1e3jc9Tc2e3jc9Td1e3jc9Td2e3jc9Te1e3jc9Te2e3jc9Tf1e3jc9Tf2e3jc9Tg1e3jc9Tg2e3jc9Th1e3jc9Th2e3jc9Ti1e3jc9Ti2e3jc9Tj1e3jc9Tj2e3jc9Tk1e3jc9Tk2e3jc9Tl1e3jc9Tl2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Ma1 | Ma:37-213 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Ma2 | Ma:214-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mb1 | Mb:37-213 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mb2 | Mb:214-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mc1 | Mc:37-213 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mc2 | Mc:214-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Md1 | Md:37-213 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Md2 | Md:214-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Me1 | Me:37-213 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Me2 | Me:214-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mf1 | Mf:37-213 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mf2 | Mf:214-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mg1 | Mg:213-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mg2 | Mg:37-212 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mh1 | Mh:37-213 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mh2 | Mh:214-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mi1 | Mi:213-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mi2 | Mi:37-212 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mj1 | Mj:213-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mj2 | Mj:37-212 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mk1 | Mk:37-213 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Mk2 | Mk:214-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Ml1 | Ml:213-391 |
| Q1D0B0 | DB00171 | ATP | 3jc9 | e3jc9Ml2 | Ml:37-212 |