Attributes
UniProt ID
Protein Name
D-galactonate dehydratase family member ManD
Ligand Name
D-MANNONIC ACID
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGHNJXZEOKUKBD-MBMOQRBOSA-N
SMILES
C(C(C(C(C(C(=O)O)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3P93
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3p93A5e3p93A6e3p93B5e3p93B6e3p93C1e3p93C2e3p93D5e3p93D6e3p93E5e3p93E6e3p93F1e3p93F2e3p93G1e3p93G2e3p93H1e3p93H2
ECOD domains from experimental PDB structures interacting with ligand CS2
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q1QT89 | n/a | CS2 | 3p93 | e3p93A5 | A:3-141 |
| Q1QT89 | n/a | CS2 | 3p93 | e3p93A6 | A:142-156,A:176-405 |
| Q1QT89 | n/a | CS2 | 3p93 | e3p93B5 | B:3-113 |
| Q1QT89 | n/a | CS2 | 3p93 | e3p93B6 | B:114-405 |
| Q1QT89 | n/a | CS2 | 3p93 | e3p93D5 | D:3-141 |
| Q1QT89 | n/a | CS2 | 3p93 | e3p93E5 | E:3-113 |
| Q1QT89 | n/a | CS2 | 3p93 | e3p93E6 | E:114-405 |
| Q1QT89 | n/a | CS2 | 3p93 | e3p93F1 | F:3-112 |
| Q1QT89 | n/a | CS2 | 3p93 | e3p93F2 | F:113-405 |
| Q1QT89 | n/a | CS2 | 3p93 | e3p93H1 | H:3-112 |
| Q1QT89 | n/a | CS2 | 4kpl | e4kplA1 | A:2-112 |
| Q1QT89 | n/a | CS2 | 4kpl | e4kplA2 | A:113-156,A:177-405 |
| Q1QT89 | n/a | CS2 | 4kpl | e4kplB1 | B:114-405 |
| Q1QT89 | n/a | CS2 | 4kpl | e4kplB2 | B:3-113 |
| Q1QT89 | n/a | CS2 | 4kpl | e4kplD1 | D:3-141 |
| Q1QT89 | n/a | CS2 | 4kpl | e4kplE1 | E:114-405 |
| Q1QT89 | n/a | CS2 | 4kpl | e4kplE2 | E:3-113 |
| Q1QT89 | n/a | CS2 | 4kpl | e4kplF1 | F:114-405 |
| Q1QT89 | n/a | CS2 | 4kpl | e4kplF2 | F:3-113 |
| Q1QT89 | n/a | CS2 | 4kpl | e4kplH1 | H:2-112 |