Attributes
UniProt ID
Protein Name
Obelin
Ligand Name
C2-HYDROPEROXY-COELENTERAZINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HOSWCJDTHOAORT-SANMLTNESA-N
SMILES
c1ccc(cc1)CC2=NC(=CN3C2=NC(C3=O)(Cc4ccc(cc4)O)OO)c5ccc(cc5)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1JF0
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1jf0A1e1jf0A2
ECOD domains from experimental PDB structures interacting with ligand DB02241
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q27709 | DB02241 | CZH | 1jf0 | e1jf0A1 | A:108-195 |
| Q27709 | DB02241 | CZH | 1jf0 | e1jf0A2 | A:7-107 |
| Q27709 | DB02241 | CZH | 1jf2 | e1jf2A1 | A:108-195 |
| Q27709 | DB02241 | CZH | 1jf2 | e1jf2A2 | A:7-107 |
| Q27709 | DB02241 | CZH | 1qv0 | e1qv0A1 | A:108-195 |
| Q27709 | DB02241 | CZH | 1qv0 | e1qv0A2 | A:7-107 |
| Q27709 | DB02241 | CZH | 1qv1 | e1qv1A1 | A:108-195 |
| Q27709 | DB02241 | CZH | 1qv1 | e1qv1A3 | A:5-107 |
| Q27709 | DB02241 | CZH | 1sl9 | e1sl9A1 | A:108-195 |
| Q27709 | DB02241 | CZH | 1sl9 | e1sl9A3 | A:5-107 |
| Q27709 | DB02241 | CZH | 4mrx | e4mrxA1 | A:6-107 |
| Q27709 | DB02241 | CZH | 4mrx | e4mrxA2 | A:108-195 |
| Q27709 | DB02241 | CZH | 4n1f | e4n1fA1 | A:108-195 |
| Q27709 | DB02241 | CZH | 4n1f | e4n1fA2 | A:6-107 |
| Q27709 | DB02241 | CZH | 8c6o | e8c6oA1 | A:108-195 |
| Q27709 | DB02241 | CZH | 8c6o | e8c6oA2 | A:1-107 |
| Q27709 | DB02241 | CZH | 8c6o | e8c6oB1 | B:108-195 |
| Q27709 | DB02241 | CZH | 8c6o | e8c6oB2 | B:2-107 |