Attributes
UniProt ID
Protein Name
Glyceraldehyde-3-phosphate dehydrogenase, glycosomal
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1A7K
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1a7kA1e1a7kA2e1a7kB1e1a7kB2e1a7kC1e1a7kC2e1a7kD1e1a7kD2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q27890 | DB14128 | NAD | 1a7k | e1a7kA1 | A:166-334 |
| Q27890 | DB14128 | NAD | 1a7k | e1a7kA2 | A:3-165,A:335-355 |
| Q27890 | DB14128 | NAD | 1a7k | e1a7kB1 | B:166-334 |
| Q27890 | DB14128 | NAD | 1a7k | e1a7kB2 | B:3-165,B:335-355 |
| Q27890 | DB14128 | NAD | 1a7k | e1a7kC1 | C:166-334 |
| Q27890 | DB14128 | NAD | 1a7k | e1a7kC2 | C:3-165,C:335-355 |
| Q27890 | DB14128 | NAD | 1a7k | e1a7kD1 | D:166-334 |
| Q27890 | DB14128 | NAD | 1a7k | e1a7kD2 | D:3-165,D:335-355 |
| Q27890 | DB14128 | NAD | 1gyp | e1gypA1 | A:166-334 |
| Q27890 | DB14128 | NAD | 1gyp | e1gypA2 | A:3-165,A:335-355 |
| Q27890 | DB14128 | NAD | 1gyp | e1gypB1 | B:166-334 |
| Q27890 | DB14128 | NAD | 1gyp | e1gypB2 | B:3-165,B:335-355 |
| Q27890 | DB14128 | NAD | 1gyp | e1gypC1 | C:166-334 |
| Q27890 | DB14128 | NAD | 1gyp | e1gypC2 | C:3-165,C:335-355 |
| Q27890 | DB14128 | NAD | 1gyp | e1gypD1 | D:166-334 |
| Q27890 | DB14128 | NAD | 1gyp | e1gypD2 | D:3-165,D:335-355 |