Attributes
UniProt ID
Protein Name
Coenzyme A disulfide reductase
Ligand Name
COENZYME A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGJOEKWQDUBAIZ-IBOSZNHHSA-N
SMILES
CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4EQR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4eqrA7e4eqrA8e4eqrA9e4eqrB7e4eqrB8e4eqrB9
ECOD domains from experimental PDB structures interacting with ligand DB01992
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q2FIA5 | DB01992 | COA | 4eqr | e4eqrA7 | A:318-438 |
| Q2FIA5 | DB01992 | COA | 4eqr | e4eqrA8 | A:2-120 |
| Q2FIA5 | DB01992 | COA | 4eqr | e4eqrA9 | A:121-317 |
| Q2FIA5 | DB01992 | COA | 4eqr | e4eqrB7 | B:318-438 |
| Q2FIA5 | DB01992 | COA | 4eqr | e4eqrB8 | B:2-120 |
| Q2FIA5 | DB01992 | COA | 4eqr | e4eqrB9 | B:121-317 |
| Q2FIA5 | DB01992 | COA | 4eqs | e4eqsA7 | A:318-438 |
| Q2FIA5 | DB01992 | COA | 4eqs | e4eqsA8 | A:2-120 |
| Q2FIA5 | DB01992 | COA | 4eqs | e4eqsA9 | A:121-317 |
| Q2FIA5 | DB01992 | COA | 4eqs | e4eqsB7 | B:318-438 |
| Q2FIA5 | DB01992 | COA | 4eqs | e4eqsB8 | B:2-120 |
| Q2FIA5 | DB01992 | COA | 4eqs | e4eqsB9 | B:121-317 |
| Q2FIA5 | DB01992 | COA | 4eqw | e4eqwA7 | A:318-438 |
| Q2FIA5 | DB01992 | COA | 4eqw | e4eqwA8 | A:2-120 |
| Q2FIA5 | DB01992 | COA | 4eqw | e4eqwA9 | A:121-317 |
| Q2FIA5 | DB01992 | COA | 4eqw | e4eqwB7 | B:318-438 |
| Q2FIA5 | DB01992 | COA | 4eqw | e4eqwB8 | B:2-147 |
| Q2FIA5 | DB01992 | COA | 4eqw | e4eqwB9 | B:148-317 |