Attributes
UniProt ID
Protein Name
Cyanuric acid amidohydrolase
Ligand Name
CITRIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KRKNYBCHXYNGOX-UHFFFAOYSA-N
SMILES
C(C(=O)O)C(CC(=O)O)(C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6DHJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6dhjA1e6dhjA2e6dhjA3e6dhjB1e6dhjB2e6dhjB3e6dhjC1e6dhjC2e6dhjC3e6dhjD1e6dhjD2e6dhjD3e6dhjE1e6dhjE2e6dhjE3e6dhjF1e6dhjF2e6dhjF3e6dhjG1e6dhjG2e6dhjG3e6dhjH1e6dhjH2e6dhjH3
ECOD domains from experimental PDB structures interacting with ligand DB04272
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjA1 | A:252-370 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjA2 | A:105-251 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjA3 | A:1-104 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjB1 | B:105-251 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjB2 | B:252-368 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjB3 | B:1-104 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjC1 | C:252-367 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjC2 | C:1-104 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjC3 | C:105-251 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjD1 | D:105-251 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjD2 | D:252-369 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjD3 | D:1-104 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjE1 | E:252-369 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjE2 | E:1-104 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjE3 | E:105-251 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjF1 | F:105-251 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjF2 | F:252-368 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjF3 | F:1-104 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjG1 | G:1-104 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjG2 | G:105-251 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjG3 | G:252-367 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjH1 | H:105-251 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjH2 | H:252-368 |
| Q2RGM7 | DB04272 | CIT | 6dhj | e6dhjH3 | H:1-104 |