Attributes
UniProt ID
Protein Name
DNA-directed DNA polymerase
Ligand Name
2'-DEOXYGUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HAAZLUGHYHWQIW-KVQBGUIXSA-N
SMILES
c1nc2c(n1C3CC(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3QES
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3qesA4e3qesA5e3qesA6e3qesA7
ECOD domains from experimental PDB structures interacting with ligand DB02181
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q38087 | DB02181 | DGT | 3qes | e3qesA4 | A:1-375 |
| Q38087 | DB02181 | DGT | 3qes | e3qesA6 | A:469-574 |
| Q38087 | DB02181 | DGT | 3qes | e3qesA7 | A:376-468,A:575-732 |
| Q38087 | DB02181 | DGT | 3qex | e3qexA6 | A:469-574 |
| Q38087 | DB02181 | DGT | 3qex | e3qexA7 | A:376-468,A:575-732 |
| Q38087 | DB02181 | DGT | 3qnn | e3qnnA7 | A:469-574 |
| Q38087 | DB02181 | DGT | 3qnn | e3qnnA8 | A:376-468,A:575-732 |
| Q38087 | DB02181 | DGT | 4dtp | e4dtpA6 | A:469-574 |
| Q38087 | DB02181 | DGT | 4dtp | e4dtpA7 | A:376-468,A:575-732 |
| Q38087 | DB02181 | DGT | 4dtu | e4dtuA4 | A:1-375 |
| Q38087 | DB02181 | DGT | 4dtu | e4dtuA6 | A:469-574 |
| Q38087 | DB02181 | DGT | 4dtu | e4dtuA7 | A:376-468,A:575-732 |
| Q38087 | DB02181 | DGT | 4fj7 | e4fj7A6 | A:469-574 |
| Q38087 | DB02181 | DGT | 4fj7 | e4fj7A7 | A:376-468,A:575-732 |
| Q38087 | DB02181 | DGT | 4fjh | e4fjhA6 | A:469-574 |
| Q38087 | DB02181 | DGT | 4fjh | e4fjhA7 | A:376-468,A:575-732 |
| Q38087 | DB02181 | DGT | 4fjl | e4fjlA6 | A:469-574 |
| Q38087 | DB02181 | DGT | 4fjl | e4fjlA7 | A:376-468,A:575-732 |
| Q38087 | DB02181 | DGT | 4fk4 | e4fk4A6 | A:469-574 |
| Q38087 | DB02181 | DGT | 4fk4 | e4fk4A7 | A:376-468,A:575-732 |