Attributes
UniProt ID
Protein Name
Chlorophyll a-b binding protein, chloroplastic
Ligand Name
CHLOROPHYLL B
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MWVCRINOIIOUAU-UYSPMESUSA-M
SMILES
CCC1=C(c2cc3c(c(c4n3[Mg]56[n+]2c1cc7n5c8c(c9[n+]6c(c4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C(C(=O)c8c7C)C(=O)OC)C)C=C)C=O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7YCA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7yca11e7yca21e7yca31e7yca41e7yca51e7ycaA1e7ycaA2e7ycaB1e7ycaB2e7ycaC1e7ycaD1e7ycaE1e7ycaF1e7ycaG1e7ycaH1e7ycaI1e7ycaJ1e7ycaK1e7ycaL1e7ycaM1e7ycaN1e7ycaP1e7ycaQ1e7ycaR1e7ycaS1e7ycaT1e7ycaU1e7ycaV1e7ycaW1e7ycaX1
ECOD domains from experimental PDB structures interacting with ligand DB04506
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q3B9U7 | DB04506 | CHL | 7yca | e7ycaP1 | P:33-233 |
| Q3B9U7 | DB04506 | CHL | 7yca | e7ycaR1 | R:33-233 |
| Q3B9U7 | DB04506 | CHL | 7yca | e7ycaS1 | S:53-233 |
| Q3B9U7 | DB04506 | CHL | 7yca | e7ycaT1 | T:33-233 |
| Q3B9U7 | DB04506 | CHL | 7yca | e7ycaU1 | U:33-233 |
| Q3B9U7 | DB04506 | CHL | 7yca | e7ycaV1 | V:33-233 |
| Q3B9U7 | DB04506 | CHL | 7yca | e7ycaW1 | W:34-233 |
| Q3B9U7 | DB04506 | CHL | 7yca | e7ycaX1 | X:34-233 |
| Q3B9U7 | DB04506 | CHL | 8hg3 | e8hg3S1 | S:53-233 |
| Q3B9U7 | DB04506 | CHL | 8hg3 | e8hg3T1 | T:33-233 |
| Q3B9U7 | DB04506 | CHL | 8hg3 | e8hg3U1 | U:33-233 |
| Q3B9U7 | DB04506 | CHL | 8hg5 | e8hg5P1 | P:33-233 |
| Q3B9U7 | DB04506 | CHL | 8hg5 | e8hg5R1 | R:33-233 |
| Q3B9U7 | DB04506 | CHL | 8hg6 | e8hg6V1 | V:33-233 |
| Q3B9U7 | DB04506 | CHL | 8hg6 | e8hg6W1 | W:34-233 |
| Q3B9U7 | DB04506 | CHL | 8hg6 | e8hg6X1 | X:34-233 |