Attributes
UniProt ID
Protein Name
Reaction center protein L chain
Ligand Name
BACTERIOCHLOROPHYLL A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DSJXIQQMORJERS-AGGZHOMASA-M
SMILES
CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2GMR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2gmrH1e2gmrH2e2gmrL1e2gmrM1
ECOD domains from experimental PDB structures interacting with ligand DB01853
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q3J1A5 | DB01853 | BCL | 2gmr | e2gmrL1 | L:1-280 |
| Q3J1A5 | DB01853 | BCL | 5lri | e5lriL1 | L:1-281 |
| Q3J1A5 | DB01853 | BCL | 7f0l | e7f0lL1 | L:1-281 |
| Q3J1A5 | DB01853 | BCL | 7p2c | e7p2cL1 | L:1-281 |
| Q3J1A5 | DB01853 | BCL | 7pil | e7pilL1 | L:1-281 |
| Q3J1A5 | DB01853 | BCL | 7va9 | e7va9L1 | L:1-281 |
| Q3J1A5 | DB01853 | BCL | 7va9 | e7va9l1 | l:1-281 |
| Q3J1A5 | DB01853 | BCL | 7vb9 | e7vb9L1 | L:1-268 |
| Q3J1A5 | DB01853 | BCL | 7vb9 | e7vb9l1 | l:1-281 |
| Q3J1A5 | DB01853 | BCL | 7vnm | e7vnmL1 | L:1-281 |
| Q3J1A5 | DB01853 | BCL | 7vny | e7vnyL1 | L:1-281 |
| Q3J1A5 | DB01853 | BCL | 7vor | e7vorL1 | L:1-281 |
| Q3J1A5 | DB01853 | BCL | 7vor | e7vorl1 | l:1-281 |
| Q3J1A5 | DB01853 | BCL | 7vot | e7votL1 | L:1-281 |
| Q3J1A5 | DB01853 | BCL | 7vot | e7votl1 | l:1-281 |
| Q3J1A5 | DB01853 | BCL | 7voy | e7voyL1 | L:1-281 |