Attributes
UniProt ID
Protein Name
Reaction center protein M chain
Ligand Name
BACTERIOCHLOROPHYLL A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DSJXIQQMORJERS-AGGZHOMASA-M
SMILES
CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5LRI
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5lriH1e5lriH2e5lriL1e5lriM1
ECOD domains from experimental PDB structures interacting with ligand DB01853
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q3J1A6 | DB01853 | BCL | 5lri | e5lriM1 | M:3-302 |
| Q3J1A6 | DB01853 | BCL | 7f0l | e7f0lM1 | M:1-306 |
| Q3J1A6 | DB01853 | BCL | 7p2c | e7p2cM1 | M:1-302 |
| Q3J1A6 | DB01853 | BCL | 7pil | e7pilM1 | M:1-307 |
| Q3J1A6 | DB01853 | BCL | 7pqd | e7pqdM1 | M:1-307 |
| Q3J1A6 | DB01853 | BCL | 7pqd | e7pqdm1 | m:1-307 |
| Q3J1A6 | DB01853 | BCL | 7va9 | e7va9M1 | M:2-306 |
| Q3J1A6 | DB01853 | BCL | 7va9 | e7va9m1 | m:2-306 |
| Q3J1A6 | DB01853 | BCL | 7vb9 | e7vb9M1 | M:2-306 |
| Q3J1A6 | DB01853 | BCL | 7vb9 | e7vb9m1 | m:2-306 |
| Q3J1A6 | DB01853 | BCL | 7vnm | e7vnmM1 | M:2-306 |
| Q3J1A6 | DB01853 | BCL | 7vny | e7vnyM1 | M:2-306 |
| Q3J1A6 | DB01853 | BCL | 7vor | e7vorM1 | M:1-307 |
| Q3J1A6 | DB01853 | BCL | 7vor | e7vorm1 | m:1-307 |
| Q3J1A6 | DB01853 | BCL | 7vot | e7votM1 | M:1-307 |
| Q3J1A6 | DB01853 | BCL | 7vot | e7votm1 | m:1-307 |
| Q3J1A6 | DB01853 | BCL | 7voy | e7voyM1 | M:2-306 |