Attributes
UniProt ID
Protein Name
Anaerobic nitric oxide reductase flavorubredoxin
Ligand Name
FLAVIN MONONUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FVTCRASFADXXNN-SCRDCRAPSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4D02
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4d02A1e4d02A2
ECOD domains from experimental PDB structures interacting with ligand DB03247
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q46877 | DB03247 | FMN | 4d02 | e4d02A1 | A:250-400 |
| Q46877 | DB03247 | FMN | 5lld | e5lldA2 | A:250-400 |
| Q46877 | DB03247 | FMN | 5lmc | e5lmcA1 | A:250-400,A:428-431,A:461-464 |
| Q46877 | DB03247 | FMN | 6etb | e6etbA2 | A:250-401 |
| Q46877 | DB03247 | FMN | 6etb | e6etbB2 | B:250-401 |
| Q46877 | DB03247 | FMN | 7r0f | e7r0fA1 | A:250-401 |
| Q46877 | DB03247 | FMN | 7r0f | e7r0fB2 | B:250-401 |
| Q46877 | DB03247 | FMN | 7r1h | e7r1hA1 | A:250-401 |
| Q46877 | DB03247 | FMN | 7r1h | e7r1hB1 | B:250-401 |
| Q46877 | DB03247 | FMN | 7r1j | e7r1jA1 | A:250-401 |
| Q46877 | DB03247 | FMN | 7r1j | e7r1jB2 | B:250-401 |
| Q46877 | DB03247 | FMN | 7r2o | e7r2oA2 | A:250-402 |
| Q46877 | DB03247 | FMN | 7r2o | e7r2oB1 | B:250-402 |
| Q46877 | DB03247 | FMN | 7r2p | e7r2pA1 | A:250-401 |
| Q46877 | DB03247 | FMN | 7r2p | e7r2pB1 | B:250-401 |
| Q46877 | DB03247 | FMN | 7r2r | e7r2rA1 | A:250-401 |
| Q46877 | DB03247 | FMN | 7r2r | e7r2rB2 | B:250-401 |
| Q46877 | DB03247 | FMN | 7r2s | e7r2sA2 | A:250-401 |
| Q46877 | DB03247 | FMN | 7r2s | e7r2sB1 | B:250-401 |