Attributes
UniProt ID
Protein Name
Glucarate dehydratase-related protein
Ligand Name
CITRIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KRKNYBCHXYNGOX-UHFFFAOYSA-N
SMILES
C(C(=O)O)C(CC(=O)O)(C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4GYP
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4gypA1e4gypA2e4gypB1e4gypB2e4gypC3e4gypC4e4gypD3e4gypD4
ECOD domains from experimental PDB structures interacting with ligand DB04272
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q46915 | DB04272 | CIT | 4gyp | e4gypC3 | C:6-136 |
| Q46915 | DB04272 | CIT | 4gyp | e4gypC4 | C:137-446 |
| Q46915 | DB04272 | CIT | 4gyp | e4gypD3 | D:6-136 |
| Q46915 | DB04272 | CIT | 4gyp | e4gypD4 | D:137-445 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0A1 | A:6-132 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0A2 | A:133-445 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0B3 | B:6-136 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0B4 | B:137-445 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0C3 | C:6-136 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0C4 | C:137-445 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0D5 | D:6-136 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0D6 | D:137-445 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0E5 | E:137-445 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0E6 | E:6-87,E:107-136 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0F3 | F:7-136 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0F4 | F:137-445 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0G5 | G:137-445 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0G6 | G:7-87,G:109-136 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0H3 | H:6-136 |
| Q46915 | DB04272 | CIT | 4il0 | e4il0H4 | H:137-445 |