Attributes
UniProt ID
Protein Name
Cysteine desulfurase CsdA
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4LW2
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4lw2A1e4lw2A2e4lw2B1e4lw2B2e4lw2C1e4lw2C2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q46925 | DB00114 | PLP | 4lw2 | e4lw2A1 | A:2-295 |
| Q46925 | DB00114 | PLP | 4lw2 | e4lw2B1 | B:2-295 |
| Q46925 | DB00114 | PLP | 4lw2 | e4lw2C1 | C:3-295 |
| Q46925 | DB00114 | PLP | 4lw4 | e4lw4A2 | A:3-295 |
| Q46925 | DB00114 | PLP | 4lw4 | e4lw4B2 | B:3-295 |
| Q46925 | DB00114 | PLP | 5ft4 | e5ft4A1 | A:2-295 |
| Q46925 | DB00114 | PLP | 5ft4 | e5ft4B1 | B:2-295 |
| Q46925 | DB00114 | PLP | 5ft5 | e5ft5A1 | A:1-295 |
| Q46925 | DB00114 | PLP | 5ft5 | e5ft5B1 | B:1-295 |
| Q46925 | DB00114 | PLP | 5ft6 | e5ft6A1 | A:1-295 |
| Q46925 | DB00114 | PLP | 5ft6 | e5ft6B2 | B:2-295 |
| Q46925 | DB00114 | PLP | 5ft8 | e5ft8A2 | A:1-295 |
| Q46925 | DB00114 | PLP | 5ft8 | e5ft8C1 | C:1-295 |
| Q46925 | DB00114 | PLP | 5ft8 | e5ft8E2 | E:1-295 |
| Q46925 | DB00114 | PLP | 5ft8 | e5ft8G1 | G:1-295 |
| Q46925 | DB00114 | PLP | 5ft8 | e5ft8I2 | I:1-295 |
| Q46925 | DB00114 | PLP | 5ft8 | e5ft8K1 | K:1-295 |
| Q46925 | DB00114 | PLP | 5ft8 | e5ft8M1 | M:3-295 |
| Q46925 | DB00114 | PLP | 5ft8 | e5ft8O2 | O:3-295 |