Attributes
UniProt ID
Protein Name
DNA polymerase IV
Ligand Name
DIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XPPKVPWEQAFLFU-UHFFFAOYSA-J
SMILES
[O-]P(=O)([O-])OP(=O)([O-])[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5YUX
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5yuxA1e5yuxA2e5yuxA3e5yuxA4e5yuxF1e5yuxF2e5yuxF3e5yuxF4
ECOD domains from experimental PDB structures interacting with ligand DPO
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q47155 | n/a | DPO | 5yux | e5yuxA2 | A:23-75 |
| Q47155 | n/a | DPO | 5yux | e5yuxA4 | A:0-22,A:76-177 |
| Q47155 | n/a | DPO | 5yux | e5yuxF2 | F:23-75 |
| Q47155 | n/a | DPO | 5yux | e5yuxF4 | F:0-22,F:76-177 |
| Q47155 | n/a | DPO | 5yuy | e5yuyA2 | A:23-75 |
| Q47155 | n/a | DPO | 5yuy | e5yuyA4 | A:0-22,A:76-177 |
| Q47155 | n/a | DPO | 5yuy | e5yuyF2 | F:0-22,F:76-177 |
| Q47155 | n/a | DPO | 5yuy | e5yuyF4 | F:23-75 |
| Q47155 | n/a | DPO | 5yuz | e5yuzA3 | A:0-22,A:76-177 |
| Q47155 | n/a | DPO | 5yuz | e5yuzA4 | A:23-75 |
| Q47155 | n/a | DPO | 5yuz | e5yuzF1 | F:23-75 |
| Q47155 | n/a | DPO | 5yuz | e5yuzF2 | F:0-22,F:76-177 |
| Q47155 | n/a | DPO | 5yv0 | e5yv0A2 | A:0-22,A:76-177 |
| Q47155 | n/a | DPO | 5yv0 | e5yv0A3 | A:23-75 |
| Q47155 | n/a | DPO | 5yv1 | e5yv1A1 | A:23-75 |
| Q47155 | n/a | DPO | 5yv1 | e5yv1A2 | A:0-22,A:76-177 |
| Q47155 | n/a | DPO | 5yv3 | e5yv3F2 | F:23-75 |
| Q47155 | n/a | DPO | 5yv3 | e5yv3F3 | F:0-22,F:76-177 |
| Q47155 | n/a | DPO | 5zlv | e5zlvA1 | A:23-75 |
| Q47155 | n/a | DPO | 5zlv | e5zlvA3 | A:0-22,A:76-177 |
| Q47155 | n/a | DPO | 6ig1 | e6ig1A2 | A:0-22,A:76-177 |
| Q47155 | n/a | DPO | 6ig1 | e6ig1A4 | A:23-75 |
| Q47155 | n/a | DPO | 6ig1 | e6ig1F2 | F:23-75 |
| Q47155 | n/a | DPO | 6ig1 | e6ig1F4 | F:0-22,F:76-177 |