Attributes
UniProt ID
Protein Name
Sodium/potassium-transporting ATPase subunit alpha
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7WYU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7wyuA1e7wyuA2e7wyuA3e7wyuA4e7wyuB1e7wyuB2e7wyuC1e7wyuC2e7wyuC3e7wyuC4e7wyuD1e7wyuD2e7wyuE1e7wyuG1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q4H132 | DB00171 | ATP | 7wyu | e7wyuA1 | A:386-593 |
| Q4H132 | DB00171 | ATP | 7wyu | e7wyuA3 | A:167-276 |
| Q4H132 | DB00171 | ATP | 7wyu | e7wyuC3 | C:167-276 |
| Q4H132 | DB00171 | ATP | 7wyu | e7wyuC4 | C:386-593 |
| Q4H132 | DB00171 | ATP | 7wyv | e7wyvA1 | A:386-593 |
| Q4H132 | DB00171 | ATP | 7wyv | e7wyvA3 | A:167-276 |
| Q4H132 | DB00171 | ATP | 7wyv | e7wyvC1 | C:167-276 |
| Q4H132 | DB00171 | ATP | 7wyv | e7wyvC2 | C:386-593 |
| Q4H132 | DB00171 | ATP | 7wyx | e7wyxA3 | A:386-593 |
| Q4H132 | DB00171 | ATP | 7wyx | e7wyxA4 | A:167-276 |
| Q4H132 | DB00171 | ATP | 7wyx | e7wyxC3 | C:167-276 |
| Q4H132 | DB00171 | ATP | 7wyx | e7wyxC4 | C:386-593 |
| Q4H132 | DB00171 | ATP | 7y46 | e7y46A3 | A:371-385,A:594-762 |
| Q4H132 | DB00171 | ATP | 7y46 | e7y46A4 | A:386-593 |
| Q4H132 | DB00171 | ATP | 7y46 | e7y46C1 | C:371-385,C:594-762 |
| Q4H132 | DB00171 | ATP | 7y46 | e7y46C4 | C:386-593 |