Attributes
UniProt ID
Protein Name
Sodium/potassium-transporting ATPase subunit alpha
Ligand Name
CHOLESTEROL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HVYWMOMLDIMFJA-DPAQBDIFSA-N
SMILES
CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2ZXE
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2zxeA2e2zxeA5e2zxeA6e2zxeA7e2zxeB1e2zxeB2e2zxeG1
ECOD domains from experimental PDB structures interacting with ligand DB04540
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q4H132 | DB04540 | CLR | 2zxe | e2zxeA7 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 3a3y | e3a3yA7 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5avq | e5avqA4 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5avr | e5avrA2 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5avs | e5avsA2 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5avt | e5avtA3 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5avu | e5avuA1 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5avv | e5avvA1 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5avw | e5avwA1 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5avx | e5avxA4 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5avy | e5avyA1 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5avz | e5avzA4 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5aw0 | e5aw0A4 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5aw1 | e5aw1A3 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5aw2 | e5aw2A2 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5aw3 | e5aw3A3 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5aw4 | e5aw4A1 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5aw5 | e5aw5A3 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5aw6 | e5aw6A1 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5aw7 | e5aw7A3 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5aw8 | e5aw8A1 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 5aw9 | e5aw9A3 | A:32-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyu | e7wyuA4 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyu | e7wyuC2 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyv | e7wyvA4 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyv | e7wyvC3 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyw | e7wywA1 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyw | e7wywC4 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyx | e7wyxA2 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyx | e7wyxC1 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyy | e7wyyA3 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyy | e7wyyC2 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyz | e7wyzA4 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 7wyz | e7wyzC4 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB04540 | CLR | 7wz0 | e7wz0A2 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 7wz0 | e7wz0C4 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB04540 | CLR | 7y45 | e7y45A3 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 7y45 | e7y45C1 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB04540 | CLR | 7y46 | e7y46A2 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 7y46 | e7y46C2 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB04540 | CLR | 8jfz | e8jfzA4 | A:37-166,A:277-370,A:763-1023 |
| Q4H132 | DB04540 | CLR | 8jfz | e8jfzC3 | C:37-166,C:277-370,C:763-1023 |