Attributes
UniProt ID
Protein Name
Sodium/potassium-transporting ATPase subunit alpha
Ligand Name
1,2-DIOLEOYL-SN-GLYCERO-3-PHOSPHOCHOLINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SNKAWJBJQDLSFF-NVKMUCNASA-O
SMILES
CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7WYU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7wyuA1e7wyuA2e7wyuA3e7wyuA4e7wyuB1e7wyuB2e7wyuC1e7wyuC2e7wyuC3e7wyuC4e7wyuD1e7wyuD2e7wyuE1e7wyuG1
ECOD domains from experimental PDB structures interacting with ligand DB03690
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q4H132 | DB03690 | PCW | 7wyu | e7wyuA4 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB03690 | PCW | 7wyu | e7wyuC2 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB03690 | PCW | 7wyv | e7wyvA4 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB03690 | PCW | 7wyv | e7wyvC3 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB03690 | PCW | 7wyw | e7wywA1 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB03690 | PCW | 7wyw | e7wywC4 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB03690 | PCW | 7wyx | e7wyxA2 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB03690 | PCW | 7wyx | e7wyxC1 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB03690 | PCW | 7wyy | e7wyyA3 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB03690 | PCW | 7wyy | e7wyyC2 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB03690 | PCW | 7wyz | e7wyzA4 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB03690 | PCW | 7wyz | e7wyzC4 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB03690 | PCW | 7wz0 | e7wz0A2 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB03690 | PCW | 7wz0 | e7wz0C4 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB03690 | PCW | 7y45 | e7y45A3 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB03690 | PCW | 7y45 | e7y45C1 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB03690 | PCW | 7y46 | e7y46A2 | A:31-166,A:277-370,A:763-1023 |
| Q4H132 | DB03690 | PCW | 7y46 | e7y46C2 | C:31-166,C:277-370,C:763-1023 |
| Q4H132 | DB03690 | PCW | 8jfz | e8jfzA4 | A:37-166,A:277-370,A:763-1023 |
| Q4H132 | DB03690 | PCW | 8jfz | e8jfzC3 | C:37-166,C:277-370,C:763-1023 |