Attributes
UniProt ID
Protein Name
Galactan 1,3-beta-galactosidase
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7BYS
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7bysA1e7bysA2e7bysB1e7bysB2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q50KB2 | DB00141 | NAG | 7bys | e7bysA1 | A:22-320 |
| Q50KB2 | DB00141 | NAG | 7bys | e7bysA2 | A:321-448 |
| Q50KB2 | DB00141 | NAG | 7bys | e7bysB1 | B:22-320 |
| Q50KB2 | DB00141 | NAG | 7bys | e7bysB2 | B:321-448 |
| Q50KB2 | DB00141 | NAG | 7byt | e7bytA1 | A:22-320 |
| Q50KB2 | DB00141 | NAG | 7byt | e7bytA2 | A:321-448 |
| Q50KB2 | DB00141 | NAG | 7byv | e7byvA1 | A:21-320 |
| Q50KB2 | DB00141 | NAG | 7byv | e7byvA2 | A:321-448 |
| Q50KB2 | DB00141 | NAG | 7byx | e7byxA1 | A:22-320 |
| Q50KB2 | DB00141 | NAG | 7byx | e7byxA2 | A:321-448 |
| Q50KB2 | DB00141 | NAG | 7byx | e7byxB1 | B:22-320 |
| Q50KB2 | DB00141 | NAG | 7byx | e7byxB2 | B:321-448 |
| Q50KB2 | DB00141 | NAG | 7byx | e7byxC1 | C:22-320 |
| Q50KB2 | DB00141 | NAG | 7byx | e7byxC2 | C:321-448 |
| Q50KB2 | DB00141 | NAG | 7byx | e7byxD1 | D:22-320 |
| Q50KB2 | DB00141 | NAG | 7byx | e7byxD2 | D:321-448 |